missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Carbidopa monohydrate, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 461010010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Carbidopa monohydrate | |
| 6.9% to 7.9% (1 g, 105°C) | |
| 98.5% min. (HPLC) | |
| C10H14N2O4·H2O | |
| 3-3,4-dihydroxyphenyl-2-hydrazinyl-2-methylpropanoic acid hydrate, +-2-3,4-dihydroxybenzyl-2-hydrazinopropionic acid monohydrate, 3-3,4-bis oxidanyl phenyl-2-diazanyl-2-methyl-propanoic acid hydrate | |
| CC(CC1=CC(=C(C=C1)O)O)(C(=O)O)NN.O | |
| 244.25 | |
| CHEBI:3395 | |
| 99% |
| 38821-49-7 | |
| Authentic | |
| Glass Bottle | |
| 1g | |
| QTAOMKOIBXZKND-PPHPATTJSA-N | |
| (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid;hydrate | |
| 38101 | |
| 244.25 |
Chemical Identifiers
| 38821-49-7 | |
| 244.25 | |
| 3-3,4-dihydroxyphenyl-2-hydrazinyl-2-methylpropanoic acid hydrate, +-2-3,4-dihydroxybenzyl-2-hydrazinopropionic acid monohydrate, 3-3,4-bis oxidanyl phenyl-2-diazanyl-2-methyl-propanoic acid hydrate | |
| CHEBI:3395 | |
| CC(CC1=CC(=C(C=C1)O)O)(C(=O)O)NN.O |
| C10H14N2O4·H2O | |
| QTAOMKOIBXZKND-PPHPATTJSA-N | |
| 38101 | |
| (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid;hydrate |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
GHS P Statement Wear eye protection/face protection. Wash face, hands and any exposed skin thoroughly after handling. If eye irritation persists: Get medical advice/attention.
GHS Signal Word: Warning
RUO â Research Use Only