Learn More
Carbazole, 96%
CAS: 86-74-8 | C12H9N | 167.21 g/mol
$51.94 - $187.83
Chemical Identifiers
| CAS | 86-74-8 |
|---|---|
| Molecular Formula | C12H9N |
| Molecular Weight (g/mol) | 167.21 |
| MDL Number | MFCD00004960 |
| InChI Key | UJOBWOGCFQCDNV-UHFFFAOYSA-N |
| Synonym | carbazole, dibenzopyrrole, diphenylenimine, 9-azafluorene, diphenylenimide, diphenyleneimine, dibenzo b,d pyrrole, usaf ek-600, unii-0p2197hhhn |
| PubChem CID | 6854 |
| ChEBI | CHEBI:27543 |
| IUPAC Name | 9H-carbazole |
| SMILES | N1C2=C(C=CC=C2)C2=C1C=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC108260050
|
Thermo Scientific Chemicals
108260050 |
5 g | Glass Bottle |
Each for $51.94
|
|
||||
|
AC108260250
|
Thermo Scientific Chemicals
108260250 |
25 g | Plastic bottle |
Each for $57.92
|
|
||||
|
AC108262500
|
Thermo Scientific Chemicals
108262500 |
250 g | Plastic bottle |
Each for $187.83
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 86-74-8 | |
| 167.21 | |
| UJOBWOGCFQCDNV-UHFFFAOYSA-N | |
| 6854 | |
| 9H-carbazole |
| C12H9N | |
| MFCD00004960 | |
| carbazole, dibenzopyrrole, diphenylenimine, 9-azafluorene, diphenylenimide, diphenyleneimine, dibenzo b,d pyrrole, usaf ek-600, unii-0p2197hhhn | |
| CHEBI:27543 | |
| N1C2=C(C=CC=C2)C2=C1C=CC=C2 |
Specifications
| 86-74-8 | |
| Beige-Brown or Beige-Yellow | |
| 220°C | |
| 95% min. (GC) | |
| C12H9N | |
| 5 g | |
| 15,1791 | |
| Solubility in water: insoluble. Other solubilities: slightly soluble in acetic acid- soluble in h2so4,1g/3mL quinoline- 1g/6mL pyridine- 1g/35mL ether,1g/9mL acetone- 1g/120mL benzene,1g/135mL abs. alcohol- slightly soluble in,petroleum ether and | |
| N1C2=C(C=CC=C2)C2=C1C=CC=C2 | |
| 167.21 | |
| CHEBI:27543 | |
| 96% | |
| Carbazole, 96% |
| 240.0°C to 246.0°C | |
| 355.0°C | |
| Authentic | |
| Glass Bottle | |
| MFCD00004960 | |
| 20,433 | |
| carbazole, dibenzopyrrole, diphenylenimine, 9-azafluorene, diphenylenimide, diphenyleneimine, dibenzo b,d pyrrole, usaf ek-600, unii-0p2197hhhn | |
| UJOBWOGCFQCDNV-UHFFFAOYSA-N | |
| 9H-carbazole | |
| 6854 | |
| 167.21 | |
| Crystalline Powder, Flakes, or Chunks |
Safety and Handling
GHS H Statement
Causes skin irritation.
Very toxic to aquatic life with long lasting effects.
Causes serious eye irritation.
Suspected of causing cancer.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
If skin irritation occurs: Get medical advice/attention.
If eye irritation persists: Get medical advice/attention.
Avoid breathing dust/fume/
GHS Signal Word: Warning
EINECSNumber : 201-696-0
RTECSNumber : FE3150000
TSCA : TSCA
RUO – Research Use Only