missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Carbamylcholine chloride, 98+%
CAS: 51-83-2 | C6H15ClN2O2 | 182.65 g/mol
$260.67 - $620.08
Chemical Identifiers
| CAS | 51-83-2 |
|---|---|
| Molecular Formula | C6H15ClN2O2 |
| Molecular Weight (g/mol) | 182.65 |
| MDL Number | MFCD00012011 |
| InChI Key | AIXAANGOTKPUOY-UHFFFAOYSA-N |
| Synonym | carbachol, carbamoylcholine chloride, carbachol chloride, carbacholine, carbocholine, jestryl, doryl, carbamylcholine chloride, miostat, isopto carbachol |
| PubChem CID | 5831 |
| ChEBI | CHEBI:3385 |
| IUPAC Name | 2-carbamoyloxyethyl(trimethyl)azanium;chloride |
| SMILES | [Cl-].C[N+](C)(C)CCOC(N)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC108240050
|
Thermo Scientific Chemicals
108240050 |
5 g | Glass bottle |
Each for $260.67
|
|
||||
|
AC108240250
|
Thermo Scientific Chemicals
108240250 |
25 g | Glass bottle |
Each for $620.08
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 51-83-2 | |
| 182.65 | |
| AIXAANGOTKPUOY-UHFFFAOYSA-N | |
| 5831 | |
| 2-carbamoyloxyethyl(trimethyl)azanium;chloride |
| C6H15ClN2O2 | |
| MFCD00012011 | |
| carbachol, carbamoylcholine chloride, carbachol chloride, carbacholine, carbocholine, jestryl, doryl, carbamylcholine chloride, miostat, isopto carbachol | |
| CHEBI:3385 | |
| [Cl-].C[N+](C)(C)CCOC(N)=O |
Specifications
| 200°C to 204°C | |
| White | |
| 5 g | |
| C6H15ClN2O2 | |
| MFCD00012011 | |
| carbachol, carbamoylcholine chloride, carbachol chloride, carbacholine, carbocholine, jestryl, doryl, carbamylcholine chloride, miostat, isopto carbachol | |
| AIXAANGOTKPUOY-UHFFFAOYSA-N | |
| 2-carbamoyloxyethyl(trimethyl)azanium;chloride | |
| 5831 | |
| 182.65 | |
| Authentic | |
| Glass bottle |
| 51-83-2 | |
| Crystalline Powder | |
| 99% | |
| H2NCO2CH2CH2N(CH3)3Cl | |
| 15,1781 | |
| Solubility in water: 1g/mL. Other solubilities: 1g/50 mL alcohol,1g/10 mL methanol,practically insoluble in chloroform and ether | |
| [Cl-].C[N+](C)(C)CCOC(N)=O | |
| 182.65 | |
| CHEBI:3385 | |
| 99% | |
| 2.0% max. (105°C, 2 hrs) | |
| Carbamylcholine chloride |
Safety and Handling
GHS H Statement
Fatal if swallowed.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wash face,hands and any exposed skin thoroughly after handling.
GHS Signal Word: Danger
EINECSNumber : 200-127-3
RUO – Research Use Only