Learn More
(+/-)-Camphor-10-sulfonic acid, 98%
CAS: 5872-08-2 | C10H16O4S | 232.29 g/mol
Supplier: Thermo Scientific Chemicals A1262022
| Quantity | 100 g |
|---|
Description
(+)-Camphor-10-sulfonic acid is used as a resolving agent for chiral amines and other cations. It is involved in the preparation of active pharmaceutical ingredient such as trimetaphan camsilate, which is used to reduce bleeding during neurosurgery. Further, it is involved in the transglucosidation of methyl and ethyl D-glucopyranosides by alcoholysis.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Applications(+)-Camphor-10-sulfonic acid is used as a resolving agent for chiral amines and other cations. It is involved in the preparation of active pharmaceutical ingredient such as trimetaphan camsilate, which is used to reduce bleeding during neurosurgery. Further, it is involved in the transglucosidation of methyl and ethyl D-glucopyranosides by alcoholysis.
Solubility
Soluble in water.
Notes
Hygroscopic. Incompatible with strong oxidizing agents and strong bases.
Chemical Identifiers
| 8-2-5872 | |
| 232.29 | |
| MIOPJNTWMNEORI-UHFFFAOYNA-N | |
| 18462 | |
| (7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
| C10H16O4S | |
| MFCD00074827 | |
| reychler's acid, camphorsulfonic acid, d-camphorsulfonic acid, camphersulfosaeure, --10-camphorsulfonic acid, 2-oxobornane-10-sulphonic acid, d-10-camphorsulfonic acid, 7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, l-camphor-10-sulfonic acid, +-10-camphorsulfonic acid | |
| CHEBI:55379 | |
| CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C |
Specifications
| (+/-)-Camphor-10-sulfonic acid | |
| ∼200°C (decomposition) | |
| 100 g | |
| UN3261 | |
| Hygroscopic | |
| Soluble in water. | |
| CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C | |
| 232.29 | |
| CHEBI:55379 | |
| 98% |
| 8-2-5872 | |
| C10H16O4S | |
| MFCD00074827 | |
| 3205973 | |
| reychler's acid, camphorsulfonic acid, d-camphorsulfonic acid, camphersulfosaeure, --10-camphorsulfonic acid, 2-oxobornane-10-sulphonic acid, d-10-camphorsulfonic acid, 7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, l-camphor-10-sulfonic acid, +-10-camphorsulfonic acid | |
| MIOPJNTWMNEORI-UHFFFAOYNA-N | |
| (7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl)methanesulfonic acid | |
| 18462 | |
| 232.3 |
Safety and Handling
GHS H Statement
H314-H318
Causes severe skin burns and eye damage.
Causes serious eye damage.
P260-P264b-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P501c
H314
DOTInformation : Hazard Class: 8; Packaging Group: II
EINECSNumber : 227-527-0
RTECSNumber : DT5077100
TSCA : Yes
Recommended Storage : Ambient temperatures