missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Calcium Pantothenate, U.S.P., J.T. Baker™
$5869.33 - $26156.00
Chemical Identifiers
| CAS | 137-08-6 |
|---|---|
| Molecular Formula | C18H32CaN2O10 |
| Molecular Weight (g/mol) | 476.54 |
| MDL Number | MFCD00002766 |
| InChI Key | FAPWYRCQGJNNSJ-DXHDTSSINA-L |
| Synonym | calcium pantothenate, d-pantothenic acid hemicalcium salt, d-pantothenic acid, calcium salt, pantothenic acid, calcium salt, d, r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt, beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r |
| PubChem CID | 131847364 |
| IUPAC Name | calcium bis(3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoate) |
| SMILES | [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
2002539
|
Avantor J.T.Baker
AVR144303 |
25 g | Wide Mouth Amber Glass Bottle |
Case of 4 Each for $5,869.33
|
|
||||
|
02002538
|
Avantor J.T.Baker
144308 |
1 kg | Wide Mouth Amber Glass Bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 137-08-6 | |
| 476.54 | |
| FAPWYRCQGJNNSJ-DXHDTSSINA-L | |
| 131847364 | |
| [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| C18H32CaN2O10 | |
| MFCD00002766 | |
| calcium pantothenate, d-pantothenic acid hemicalcium salt, d-pantothenic acid, calcium salt, pantothenic acid, calcium salt, d, r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt, beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r | |
| calcium bis(3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoate) |
Specifications
| 137-08-6 | |
| C18H32CaN2O10 | |
| calcium pantothenate, d-pantothenic acid hemicalcium salt, d-pantothenic acid, calcium salt, pantothenic acid, calcium salt, d, r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt, beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r | |
| [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O | |
| 476.54 | |
| 476.54 | |
| Wide Mouth Amber Glass Bottle |
| 25 g | |
| MFCD00002766 | |
| FAPWYRCQGJNNSJ-DXHDTSSINA-L | |
| calcium bis(3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoate) | |
| 131847364 | |
| USP | |
| Calcium Pantothenate |