missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Calcium Gluconate Monohydrate 98.0+%, TCI America™
$43.13 - $96.22
Chemical Identifiers
| CAS | 299-28-5 |
|---|---|
| Molecular Formula | C12H22CaO14 |
| Molecular Weight (g/mol) | 430.372 |
| MDL Number | MFCD00064209 |
| InChI Key | NEEHYRZPVYRGPP-IYEMJOQQSA-L |
| Synonym | calcium gluconate, calcium d-gluconate, calciofon, calglucon, glucobiogen, ebucin, calcicol, calcipur, calglucol, dragocal |
| PubChem CID | 9290 |
| IUPAC Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
Chemical Identifiers
| 299-28-5 | |
| 430.372 | |
| NEEHYRZPVYRGPP-IYEMJOQQSA-L | |
| 9290 | |
| C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| C12H22CaO14 | |
| MFCD00064209 | |
| calcium gluconate, calcium d-gluconate, calciofon, calglucon, glucobiogen, ebucin, calcicol, calcipur, calglucol, dragocal | |
| calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
Specifications
| 299-28-5 | |
| C12H22CaO14 | |
| 25 g | |
| NEEHYRZPVYRGPP-IYEMJOQQSA-L | |
| calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate | |
| 9290 | |
| ≥98.0% (T) | |
| Calcium Gluconate Monohydrate |
| White | |
| MFCD00064209 | |
| calcium gluconate, calcium d-gluconate, calciofon, calglucon, glucobiogen, ebucin, calcicol, calcipur, calglucol, dragocal | |
| C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] | |
| 430.372 | |
| 430.37 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (2)-1410
RTECSNumber : EW2100000
TSCA : Yes