missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Calcium D-Pantothenate 98.0+%, TCI America™
$44.79 - $257.14
Chemical Identifiers
| CAS | 137-08-6 |
|---|---|
| Molecular Formula | C18H32CaN2O10 |
| Molecular Weight (g/mol) | 476.54 |
| MDL Number | MFCD00002766 |
| InChI Key | FAPWYRCQGJNNSJ-DXHDTSSINA-L |
| Synonym | calcium pantothenate, d-pantothenic acid hemicalcium salt, d-pantothenic acid, calcium salt, pantothenic acid, calcium salt, d, r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt, beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r |
| PubChem CID | 131847364 |
| IUPAC Name | calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) |
| SMILES | [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
Chemical Identifiers
| 137-08-6 | |
| 476.54 | |
| FAPWYRCQGJNNSJ-DXHDTSSINA-L | |
| 131847364 | |
| [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| C18H32CaN2O10 | |
| MFCD00002766 | |
| calcium pantothenate, d-pantothenic acid hemicalcium salt, d-pantothenic acid, calcium salt, pantothenic acid, calcium salt, d, r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt, beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r | |
| calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) |
Specifications
| 172°C | |
| White | |
| MFCD00002766 | |
| FAPWYRCQGJNNSJ-DXHDTSSINA-L | |
| calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) | |
| 131847364 | |
| ≥98.0% (T) | |
| Crystalline Powder |
| 137-08-6 | |
| C18H32CaN2O10 | |
| calcium pantothenate, d-pantothenic acid hemicalcium salt, d-pantothenic acid, calcium salt, pantothenic acid, calcium salt, d, r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt, beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r | |
| [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O | |
| 476.54 | |
| 476.54 | |
| 25 g | |
| Calcium D-Pantothenate |
Safety and Handling
EINECSNumber : (2)-2739
RTECSNumber : RU4375000
TSCA : Yes