missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Bromothymol Blue sodium salt, ACS reagent
CAS: 34722-90-2 | C27H27Br2NaO5S | 646.37 g/mol
Supplier: Thermo Scientific Chemicals 403260100
| Quantity | 10 g |
|---|
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 34722-90-2 | |
| 646.37 | |
| NMKFVGALBGZKGW-FKWCIMQXSA-M | |
| 102183223 | |
| [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O |
| C27H27Br2NaO5S | |
| MFCD00077263,MFCD00077263,MFCD00077263 | |
| Bromthymol Blue, sodium salt, 3', 3''-Dibromothymolsulfonephthalein, sodium salt, BTB | |
| sodium;2-bromo-4-[(Z)-(3-bromo-2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)-(2-sulfophenyl)methyl]-3-methyl-6-propan-2-ylphenolate |
Specifications
| Bromothymol Blue sodium salt | |
| Passes Test | |
| MFCD00077263,MFCD00077263,MFCD00077263 | |
| Bromthymol Blue, sodium salt, 3', 3''-Dibromothymolsulfonephthalein, sodium salt, BTB | |
| [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O | |
| sodium;2-bromo-4-[(Z)-(3-bromo-2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)-(2-sulfophenyl)methyl]-3-methyl-6-propan-2-ylphenolate | |
| 102183223 | |
| ACS Reagent | |
| from pH 6.0 (yellow) to pH 7.6 (blue) | |
| 10 g |
| 34722-90-2 | |
| C27H27Br2NaO5S | |
| 15, 1455 | |
| NMKFVGALBGZKGW-FKWCIMQXSA-M | |
| Authentic | |
| 646.37 | |
| 646.35 | |
| Glass bottle | |
| Brown/Orange to Green | |
| Powder |