missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromothymol Blue Sodium Salt, ACS Grade, LabChem™
Supplier: LabChem LC120407
Specifications
| Bromothymol Blue Sodium Salt | |
| 100 | |
| C27H27Br2O5S·Na | |
| Soluble in water | |
| NMKFVGALBGZKGW-FKWCIMQXSA-M | |
| sodium 2-{[(1Z)-3-bromo-2-methyl-4-oxo-5-(propan-2-yl)cyclohexa-2,5-dien-1-ylidene][3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]methyl}benzene-1-sulfonate | |
| 102183223 | |
| ACS | |
| Sulfur compounds; Carbon monoxide; Carbon dioxide; Hydrogen bromide | |
| 10 g |
| 34722-90-2 | |
| C27H27Br2NaO5S | |
| MFCD00077263,MFCD00077263,MFCD00077263 | |
| Passes Test | |
| [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O | |
| 646.37 | |
| 646.37 | |
| Amber Glass | |
| Gray/Orange | |
| Powder |
Chemical Identifiers
| 34722-90-2 | |
| 646.37 | |
| NMKFVGALBGZKGW-FKWCIMQXSA-M | |
| sodium 2-{[(1Z)-3-bromo-2-methyl-4-oxo-5-(propan-2-yl)cyclohexa-2,5-dien-1-ylidene][3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]methyl}benzene-1-sulfonate |
| C27H27Br2NaO5S | |
| MFCD00077263,MFCD00077263,MFCD00077263 | |
| 102183223 | |
| [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O |
Safety and Handling
GHS H Statement
Product is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature