missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Bromophenol Red, pure
CAS: 2800-80-8 | C19H12Br2O5S | 512.168 g/mol
$194.85 - $194.85
Chemical Identifiers
| CAS | 2800-80-8 |
|---|---|
| Molecular Formula | C19H12Br2O5S |
| Molecular Weight (g/mol) | 512.168 |
| MDL Number | MFCD00023014 |
| InChI Key | OYCLSQDXZMROJK-UHFFFAOYSA-N |
| Synonym | 5', 5''-Dibromophenolsulfonphthalein |
| PubChem CID | 76047 |
| IUPAC Name | 2-bromo-4-[3-(3-bromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C=C3)O)Br)C4=CC(=C(C=C4)O)Br |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC304550050
|
Thermo Scientific Chemicals
304550050 |
5 g |
Each for $194.85
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2800-80-8 | |
| 512.168 | |
| OYCLSQDXZMROJK-UHFFFAOYSA-N | |
| 76047 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C=C3)O)Br)C4=CC(=C(C=C4)O)Br |
| C19H12Br2O5S | |
| MFCD00023014 | |
| 5', 5''-Dibromophenolsulfonphthalein | |
| 2-bromo-4-[3-(3-bromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
Specifications
| 2800-80-8 | |
| MFCD00023014 | |
| OYCLSQDXZMROJK-UHFFFAOYSA-N | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C=C3)O)Br)C4=CC(=C(C=C4)O)Br | |
| 512.168 | |
| 5% max. (110°C) | |
| Pure | |
| from pH 5.2 (yellow-red) to pH 7.0 (purple) | |
| 5 g | |
| Bromophenol Red |
| C19H12Br2O5S | |
| 5', 5''-Dibromophenolsulfonphthalein | |
| Authentic | |
| 2-bromo-4-[3-(3-bromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol | |
| 76047 | |
| 512.19 | |
| Glass bottle | |
| Brown to Brown/Red | |
| Powder |
Safety and Handling
EINECSNumber : 220-538-1
RUO – Research Use Only