missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Bromocresol Purple, pure, indicator grade
CAS: 115-40-2 | C21H16Br2O5S | 540.22 g/mol
$57.43 - $616.60
Chemical Identifiers
| CAS | 115-40-2 |
|---|---|
| Molecular Formula | C21H16Br2O5S |
| Molecular Weight (g/mol) | 540.22 |
| MDL Number | MFCD00011681 |
| InChI Key | ABIUHPWEYMSGSR-UHFFFAOYSA-N |
| Synonym | Bromcresol Purple, BCP, 5', 5''-Dibromo-o-cresolsulfonephthalein |
| PubChem CID | 8273 |
| ChEBI | CHEBI:86154 |
| SMILES | CC1=CC(=CC(Br)=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(Br)=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC151330050
|
Thermo Scientific Chemicals
151330050 |
5 g | Glass bottle |
Each for $57.43
|
|
||||
|
AC151330250
|
Thermo Scientific Chemicals
151330250 |
25 g | Glass bottle |
Each for $187.23
|
|
||||
|
AC151331400
|
Thermo Scientific Chemicals
151331400 |
140 g | Glass bottle |
Each for $616.60
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 115-40-2 | |
| 540.22 | |
| ABIUHPWEYMSGSR-UHFFFAOYSA-N | |
| 8273 | |
| CC1=CC(=CC(Br)=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(Br)=C1 |
| C21H16Br2O5S | |
| MFCD00011681 | |
| Bromcresol Purple, BCP, 5', 5''-Dibromo-o-cresolsulfonephthalein | |
| CHEBI:86154 |
Specifications
| (20 mg/L in methanol) Complies, (20 mg/L in methanol) Complies at 0nm | |
| 115-40-2 | |
| MFCD00011681 | |
| Solubility in water: practically insoluble. Other solubilities: 75g/L in ethanol (20°C) | |
| Authentic | |
| 3,3-bis(3-bromo-4-hydroxy-5-methylphenyl)-3H-2,1λâ¶-benzoxathiole-1,1-dione | |
| 8273 | |
| 540.21 | |
| Glass bottle | |
| Pink or Salmon | |
| Powder |
| 245.0°C | |
| C21H16Br2O5S | |
| Bromcresol Purple, BCP, 5', 5''-Dibromo-o-cresolsulfonephthalein | |
| ABIUHPWEYMSGSR-UHFFFAOYSA-N | |
| CC1=CC(=CC(Br)=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(Br)=C1 | |
| 540.22 | |
| CHEBI:86154 | |
| Pure | |
| from pH 5.2 (yellow) to pH 6.8 (purple) | |
| 5 g | |
| Bromocresol Purple |
RUO – Research Use Only