missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromocresol Purple Indicator, Reag. Ph. Eur., Honeywell Fluka™
Indicator, Reag. Ph. Eur.
Supplier: Honeywell Chemicals 326425G
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Bromocresol Purple | |
| Reag. Ph. Eur. | |
| C21H16Br2O5S | |
| NONH for all modes of transport | |
| ABIUHPWEYMSGSR-UHFFFAOYSA-N | |
| 2-bromo-4-[3-(3-bromo-4-hydroxy-5-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-6-methylphenol | |
| 8273 | |
| 540.22g/mol | |
| Complies for change range | |
| 5 g |
| 240°C | |
| 115-40-2 | |
| MFCD00011681 | |
| 359618 | |
| CC1=CC(=CC(Br)=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(Br)=C1 | |
| 540.22 | |
| CHEBI:86154 | |
| Glass Bottle | |
| 5.2 to 6.8 (yellow to purple) |
Chemical Identifiers
| 115-40-2 | |
| 540.22 | |
| ABIUHPWEYMSGSR-UHFFFAOYSA-N | |
| CHEBI:86154 | |
| CC1=CC(=CC(Br)=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(Br)=C1 |
| C21H16Br2O5S | |
| MFCD00011681 | |
| 8273 | |
| 2-bromo-4-[3-(3-bromo-4-hydroxy-5-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-6-methylphenol |
Safety and Handling
EINECSNumber : 204-087-8