missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Brilliant Green (Certified Biological Stain), Fisher Chemical
For use in bacteriology in media
Supplier: Fisher Chemical FLB42225
Specifications
| Brilliant Green | |
| 633-03-4 | |
| Report % | |
| MFCD00011880 | |
| NNBFNNNWANBMTI-UHFFFAOYSA-M | |
| [4-[[4-(diethylamino)phenyl]-phenylmethylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium;hydrogen sulfate | |
| 12449 | |
| Certified Biological Stain | |
| 42040 | |
| 3.9 | |
| Powder |
| 180°C | |
| Pass Test | |
| C27H34N2O4S | |
| Ethyl Green, Basic Green, Malachite Green G | |
| CCN(CC)C1=CC=C(C=C1)C(=C2C=CC(=[N+](CC)CC)C=C2)C3=CC=CC=C3.OS(=O)(=O)[O-] | |
| 482.639 | |
| 482.65 | |
| Glass Bottle | |
| Green | |
| 25 g |
Chemical Identifiers
| 633-03-4 | |
| 482.639 | |
| NNBFNNNWANBMTI-UHFFFAOYSA-M | |
| 12449 | |
| CCN(CC)C1=CC=C(C=C1)C(=C2C=CC(=[N+](CC)CC)C=C2)C3=CC=CC=C3.OS(=O)(=O)[O-] |
| C27H34N2O4S | |
| MFCD00011880 | |
| Ethyl Green, Basic Green, Malachite Green G | |
| [4-[[4-(diethylamino)phenyl]-phenylmethylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium;hydrogen sulfate |
Safety and Handling
Emergency Overview
Harmful if swallowed. Irritating to eyes and respiratory system.
NFPA
Health:2 Flammability:1 Instability:0
Signal Word: CAUTION!