missing translation for 'onlineSavingsMsg'
Learn More
Learn More
BOC-L-Tyrosine methyl ester, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 442020050
| Quantity | 5g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C15H21NO5 | |
| MFCD00191181 | |
| boc-tyr-ome, boc-l-tyrosine methyl ester, n-boc-l-tyrosine methyl ester, n-tert-butoxycarbonyl-l-tyrosine methyl ester, methyl n-boc-l-tyrosinate, methyl 2s-2-tert-butoxycarbonyl amino-3-4-hydroxyphenyl propanoate, methyl 2s-2-tert-butoxy carbonyl amino-3-4-hydroxyphenyl propanoate, s-methyl 2-tert-butoxycarbonyl amino-3-4-hydroxyphenyl propanoate, s-2-tert-butoxycarbonylamino-3-4-hydroxy-phenyl-propionic acid methyl ester | |
| methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
Specifications
| BOC-L-Tyrosine methyl ester | |
| Authentic | |
| Glass bottle | |
| MFCD00191181 | |
| boc-tyr-ome, boc-l-tyrosine methyl ester, n-boc-l-tyrosine methyl ester, n-tert-butoxycarbonyl-l-tyrosine methyl ester, methyl n-boc-l-tyrosinate, methyl 2s-2-tert-butoxycarbonyl amino-3-4-hydroxyphenyl propanoate, methyl 2s-2-tert-butoxy carbonyl amino-3-4-hydroxyphenyl propanoate, s-methyl 2-tert-butoxycarbonyl amino-3-4-hydroxyphenyl propanoate, s-2-tert-butoxycarbonylamino-3-4-hydroxy-phenyl-propionic acid methyl ester | |
| NQIFXJSLCUJHBB-LBPRGKRZSA-N | |
| methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate | |
| 7019130 | |
| 97% |
| 4326-36-7 | |
| 96% min. (HPLC) | |
| C15H21NO5 | |
| 5g | |
| 50.2 | |
| COC(=O)[C@H](CC1=CC=C(O)C=C1)NC(=O)OC(C)(C)C | |
| 295.34 | |
| 295.34 |