missing translation for 'onlineSavingsMsg'
Learn More
Learn More
BOC-DL-Valine, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 425780500
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| BOC-DL-Valine | |
| 97.5% min. (HPLC) | |
| C10H19NO4 | |
| MFCD00069973 | |
| boc-dl-valine, boc-dl-val-oh, n-boc-dl-valine, 2-tert-butoxycarbonyl amino-3-methylbutanoic acid, dl-n-tert-butoxycarbonyl valine, n-tert-butoxycarbonyl valine, 2-tert-butoxy carbonyl amino-3-methylbutanoic acid, n-tert-butoxycarbonyl-dl-valine, n-alpha-t-boc-l-valine | |
| CC(C)C(C(=O)O)NC(=O)OC(C)(C)C | |
| 217.26 | |
| 217.26 |
| 54895-12-4 | |
| Glass bottle | |
| (CH3)2CHCH(COOH)NHCOOC(CH3)3 | |
| 50g | |
| SZXBQTSZISFIAO-UHFFFAOYSA-N | |
| 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid | |
| 270655 | |
| 98% |
Chemical Identifiers
| 54895-12-4 | |
| 217.26 | |
| SZXBQTSZISFIAO-UHFFFAOYSA-N | |
| 270655 | |
| CC(C)C(C(=O)O)NC(=O)OC(C)(C)C |
| C10H19NO4 | |
| MFCD00069973 | |
| boc-dl-valine, boc-dl-val-oh, n-boc-dl-valine, 2-tert-butoxycarbonyl amino-3-methylbutanoic acid, dl-n-tert-butoxycarbonyl valine, n-tert-butoxycarbonyl valine, 2-tert-butoxy carbonyl amino-3-methylbutanoic acid, n-tert-butoxycarbonyl-dl-valine, n-alpha-t-boc-l-valine | |
| 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
RUO â Research Use Only