Learn More
(±)-BOC-alpha-Phosphonoglycine trimethyl ester, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 439210050
| Quantity | 5g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
for C-C Bond Formation (Olefination)Chemical Identifiers
| 89524-98-1 | |
| 297.24 | |
| LJHAPRKTPAREGO-ZETCQYMHSA-N | |
| 397380 | |
| COC(=O)[C@@H](NC(=O)OC(C)(C)C)P(=O)(OC)OC |
| C10H20NO7P | |
| MFCD02178893 | |
| methyl 2-tert-butoxycarbonyl amino-2-dimethoxyphosphoryl acetate, +/--boc-alpha-phosphonoglycine trimethyl ester, n-boc-2-phosphonoglycine trimethyl ester, methyl n-boc-2-dimethylphosphono glycinate, methyl 2-tert-butoxycarbonylamino-2-dimethoxyphosphoryl-acetate, boc-alpha-phosphonoglycine trimethyl ester, n-butoxycarbonyl trimethylphosphonoglycine, methyl 2-tert-butoxy carbonyl amino-2-dimethoxyphosphoryl acetate, boc-a-phosphonoglycine trimethyl ester, boc-?-phosphonoglycine trimethyl ester | |
| methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-2-(dimethoxyphosphoryl)acetate |
Specifications
| (±)-BOC-alpha-Phosphonoglycine trimethyl ester | |
| 96.0 | |
| Authentic | |
| C10H20NO7P | |
| 5g | |
| LJHAPRKTPAREGO-ZETCQYMHSA-N | |
| methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-2-(dimethoxyphosphoryl)acetate | |
| 397380 | |
| 97% |
| 89524-98-1 | |
| 100.0 | |
| 96% min. (GC) | |
| MFCD02178893 | |
| methyl 2-tert-butoxycarbonyl amino-2-dimethoxyphosphoryl acetate, +/--boc-alpha-phosphonoglycine trimethyl ester, n-boc-2-phosphonoglycine trimethyl ester, methyl n-boc-2-dimethylphosphono glycinate, methyl 2-tert-butoxycarbonylamino-2-dimethoxyphosphoryl-acetate, boc-alpha-phosphonoglycine trimethyl ester, n-butoxycarbonyl trimethylphosphonoglycine, methyl 2-tert-butoxy carbonyl amino-2-dimethoxyphosphoryl acetate, boc-a-phosphonoglycine trimethyl ester, boc-?-phosphonoglycine trimethyl ester | |
| COC(=O)[C@@H](NC(=O)OC(C)(C)C)P(=O)(OC)OC | |
| 297.24 | |
| 297.25 |
Safety and Handling
GHS H Statement
Toxic if swallowed.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
IF INHALED: Remove to f
GHS Signal Word: Danger