missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bis(triphenylphosphine)palladium(II) diacetate, 99%
CAS: 14588-08-0 | C40H36O4P2Pd | 749.09 g/mol
$183.87 - $756.84
Chemical Identifiers
| CAS | 14588-08-0 |
|---|---|
| Molecular Formula | C40H36O4P2Pd |
| Molecular Weight (g/mol) | 749.09 |
| MDL Number | MFCD00010013 |
| InChI Key | YOUIUHDWQIUKAO-UHFFFAOYSA-L |
| Synonym | bis triphenylphosphinepalladium acetate |
| PubChem CID | 73357379 |
| IUPAC Name | palladium(2+);triphenylphosphanium;diacetate |
| SMILES | CC(=O)O[Pd++]OC(C)=O.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC209270010
|
Thermo Scientific Chemicals
209270010 |
1 g | Glass bottle |
Each for $183.87
|
|
||||
|
AC209270050
|
Thermo Scientific Chemicals
209270050 |
5 g | Glass bottle |
Each for $756.84
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 14588-08-0 | |
| 749.09 | |
| YOUIUHDWQIUKAO-UHFFFAOYSA-L | |
| 73357379 | |
| CC(=O)O[Pd++]OC(C)=O.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| C40H36O4P2Pd | |
| MFCD00010013 | |
| bis triphenylphosphinepalladium acetate | |
| palladium(2+);triphenylphosphanium;diacetate |
Specifications
| 14588-08-0 | |
| Yellow | |
| 14% min. (Pd) | |
| C40H36O4P2Pd | |
| MFCD00010013 | |
| bis triphenylphosphinepalladium acetate | |
| CC(=O)O[Pd++]OC(C)=O.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 749.09 | |
| 749.08 | |
| Powder |
| 136.0°C | |
| Authentic | |
| Glass bottle | |
| [(C6H5)3P]2Pd(O2CCH3)2 | |
| 1 g | |
| YOUIUHDWQIUKAO-UHFFFAOYSA-L | |
| palladium(2+);triphenylphosphanium;diacetate | |
| 73357379 | |
| 99% | |
| Bis(triphenylphosphine)palladium(II) diacetate, 99% |
Safety and Handling
EINECSNumber : 238-628-4
RUO – Research Use Only