Learn More
Bis(trimethylsilyl)carbodiimide, 97%
CAS: 1000-70-0 | C7H18N2Si2 | 186.405 g/mol
$167.18 - $607.26
Chemical Identifiers
| CAS | 1000-70-0 |
|---|---|
| Molecular Formula | C7H18N2Si2 |
| Molecular Weight (g/mol) | 186.405 |
| MDL Number | MFCD00051538 |
| InChI Key | KSVMTHKYDGMXFJ-UHFFFAOYSA-N |
| Synonym | bis trimethylsilyl carbodiimide, carbodiimide, bis trimethylsilyl, n,n'-methanediylidenebis 1,1,1-trimethylsilanamine, silanamine, n,n'-methanetetraylbis 1,1,1-trimethyl, 1,3-bis trimethylsilyl carbodiimide, n,n'-bis trimethylsilyl carbodiimide, n,n'-methane tetraylbis 1,1,1-trimethylsilanamine, carbodiimide, bis trimethylsilyl-7ci,8ci, n,n'-methanetetraylbis 1,1,1-trimethylsilylamine |
| PubChem CID | 70473 |
| IUPAC Name | N,N'-bis(trimethylsilyl)methanediimine |
| SMILES | C[Si](C)(C)N=C=N[Si](C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1167006
|
Thermo Scientific Chemicals
A1167006 |
5 g |
Each for $167.18
|
|
|||||
|
AAA1167014
|
Thermo Scientific Chemicals
A1167014 |
25 g |
Each for $607.26
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1000-70-0 | |
| 186.405 | |
| KSVMTHKYDGMXFJ-UHFFFAOYSA-N | |
| 70473 | |
| C[Si](C)(C)N=C=N[Si](C)(C)C |
| C7H18N2Si2 | |
| MFCD00051538 | |
| bis trimethylsilyl carbodiimide, carbodiimide, bis trimethylsilyl, n,n'-methanediylidenebis 1,1,1-trimethylsilanamine, silanamine, n,n'-methanetetraylbis 1,1,1-trimethyl, 1,3-bis trimethylsilyl carbodiimide, n,n'-bis trimethylsilyl carbodiimide, n,n'-methane tetraylbis 1,1,1-trimethylsilanamine, carbodiimide, bis trimethylsilyl-7ci,8ci, n,n'-methanetetraylbis 1,1,1-trimethylsilylamine | |
| N,N'-bis(trimethylsilyl)methanediimine |
Specifications
| 1000-70-0 | |
| 0.823 | |
| 42°C (107°F) | |
| C7H18N2Si2 | |
| (CH3)3SiN=C=NSi(CH3)3 | |
| 5 g | |
| 2042082 | |
| bis trimethylsilyl carbodiimide, carbodiimide, bis trimethylsilyl, n,n'-methanediylidenebis 1,1,1-trimethylsilanamine, silanamine, n,n'-methanetetraylbis 1,1,1-trimethyl, 1,3-bis trimethylsilyl carbodiimide, n,n'-bis trimethylsilyl carbodiimide, n,n'-methane tetraylbis 1,1,1-trimethylsilanamine, carbodiimide, bis trimethylsilyl-7ci,8ci, n,n'-methanetetraylbis 1,1,1-trimethylsilylamine | |
| C[Si](C)(C)N=C=N[Si](C)(C)C | |
| 186.405 | |
| 186.41 | |
| Bis (trimethylsilyl)carbodiimide |
| -23°C | |
| 163°C to 164°C | |
| Mild | |
| 1.434 | |
| MFCD00051538 | |
| UN1993 | |
| Moisture sensitive | |
| KSVMTHKYDGMXFJ-UHFFFAOYSA-N | |
| N,N'-bis(trimethylsilyl)methanediimine | |
| 70473 | |
| 97% |
Safety and Handling
GHS H Statement
H226-H302-H315-H319-H335
Flammable liquid and vapor.
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
P210-P233-P235-P240-P241-P242-P243-P261-P264b-P270-P271-P280-P301+P312-P303+P361+P353-P304+P340-P305+P351+P338-P312-P330-P332+P313-P363-P370+P378q-P501c
H226-H302-H315-H319-H335
DOTInformation : Transport Hazard Class: 3; Packing Group: III; Proper Shipping Name: FLAMMABLE LIQUIDS, N.O.S.
EINECSNumber : 213-673-2
RTECSNumber : VV1302500
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only