Learn More
Bis(dibenzylideneacetone)palladium
CAS: 32005-36-0 | C34H28O2Pd | 575.02 g/mol
$153.70 - $153.70
Chemical Identifiers
| CAS | 32005-36-0 |
|---|---|
| Molecular Formula | C34H28O2Pd |
| Molecular Weight (g/mol) | 575.02 |
| MDL Number | MFCD00051942 |
| InChI Key | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| Synonym | bis dibenzylideneacetone palladium, bis dibenzylideneacetone palladium 0, pd dba 2, 1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium, bis dibenzyldeneacetone palladium 0, tris dibenzylideneacetone dipalladium o, palladium 0 bis dibenzylideneacetone, pubchem14428 |
| PubChem CID | 6505921 |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
| SMILES | [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC291970010
|
Thermo Scientific Chemicals
291970010 |
1 g | Glass bottle |
Each for $153.70
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 32005-36-0 | |
| 575.02 | |
| UKSZBOKPHAQOMP-SVLSSHOZSA-N | |
| 6505921 | |
| [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1 |
| C34H28O2Pd | |
| MFCD00051942 | |
| bis dibenzylideneacetone palladium, bis dibenzylideneacetone palladium 0, pd dba 2, 1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium, bis dibenzyldeneacetone palladium 0, tris dibenzylideneacetone dipalladium o, palladium 0 bis dibenzylideneacetone, pubchem14428 | |
| (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
Specifications
| 32005-36-0 | |
| Black to Brown-Red | |
| C34H28O2Pd | |
| MFCD00051942 | |
| 15,302 | |
| Solubility in water: insoluble. | |
| [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1 | |
| 575.02 | |
| 575.02 | |
| Fine Powder |
| 150.0°C | |
| Glass bottle | |
| Pd(C6H5CH=CHC(O)CH=CHC6H5)2 | |
| 1 g | |
| bis dibenzylideneacetone palladium, bis dibenzylideneacetone palladium 0, pd dba 2, 1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium, bis dibenzyldeneacetone palladium 0, tris dibenzylideneacetone dipalladium o, palladium 0 bis dibenzylideneacetone, pubchem14428 | |
| UKSZBOKPHAQOMP-SVLSSHOZSA-N | |
| (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium | |
| 6505921 | |
| 16 to 21% (Pd) | |
| Bis(dibenzylideneacetone)palladium |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
GHS P Statement
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation or rash occurs: Get medical advice/attention.
GHS Signal Word: Warning
RUO – Research Use Only