missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bis(2-ethylhexyl) adipate, 99%
CAS: 103-23-1 | C22H42O4 | 370.57 g/mol
Supplier: Thermo Scientific Chemicals 402462500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Bis(2-ethylhexyl) adipate | |
| 98.5 | |
| -76.0°C | |
| 210.0°C to 218.0°C (5.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4460 to 1.4480 | |
| 250 g | |
| bis 2-ethylhexyl adipate, di 2-ethylhexyl adipate, diethylhexyl adipate, deha, plastomoll doa, beha, vestinol oa, bisoflex doa, effomoll doa | |
| SAOKZLXYCUGLFA-UHFFFAOYSA-N | |
| bis(2-ethylhexyl) hexanedioate | |
| 7641 | |
| CHEBI:34675 | |
| 99% |
| 103-23-1 | |
| 100.0 | |
| 0.9240g/mL | |
| 196°C | |
| 98.5% min. (GC) | |
| C22H42O4 | |
| MFCD00009496 | |
| 0.924 | |
| Solubility in water: insouble. Other solubilities: soluble in aceton,ether,ethanol | |
| CCCCC(CC)COC(=O)CCCCC(=O)OCC(CC)CCCC | |
| 370.57 | |
| 13-15 mPa.s (20°C) | |
| 370.57 | |
| Liquid |
Chemical Identifiers
| 103-23-1 | |
| 370.57 | |
| SAOKZLXYCUGLFA-UHFFFAOYSA-N | |
| 7641 | |
| bis(2-ethylhexyl) hexanedioate |
| C22H42O4 | |
| MFCD00009496 | |
| bis 2-ethylhexyl adipate, di 2-ethylhexyl adipate, diethylhexyl adipate, deha, plastomoll doa, beha, vestinol oa, bisoflex doa, effomoll doa | |
| CHEBI:34675 | |
| CCCCC(CC)COC(=O)CCCCC(=O)OCC(CC)CCCC |
Safety and Handling
EINECSNumber : 203-090-1
RUO – Research Use Only