missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Biotin, Powder, USP, 97.5-102%, Spectrum™ Chemical
B1103, 58-85-5, C10H16N2O3S
Supplier: Spectrum Chemical Mfg Cor B1103500GMBL
Description
Spectrum™ Chemical Biotin, Powder, USP is used for preventing and treating biotin deficiency. Spectrum Chemical manufactured USP products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 58-85-5 | |
| Amber Glass Bottle | |
| MFCD00005541 | |
| +89° to +93° | |
| OC(=O)CCCCC1SCC2NC(=O)NC12 | |
| 244.31 | |
| USP |
| 100% | |
| C10H16N2O3S | |
| 500 g | |
| YBJHBAHKTGYVGT-UHFFFAOYNA-N | |
| 5-{2-oxo-hexahydro-1H-thieno[3,4-d]imidazol-4-yl}pentanoic acid | |
| 97.5 to 102% |
Chemical Identifiers
| 58-85-5 | |
| 244.31 | |
| YBJHBAHKTGYVGT-UHFFFAOYNA-N | |
| OC(=O)CCCCC1SCC2NC(=O)NC12 |
| C10H16N2O3S | |
| MFCD00005541 | |
| 5-{2-oxo-hexahydro-1H-thieno[3,4-d]imidazol-4-yl}pentanoic acid |