missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Fisher Science Education™ Bile Salts
Supplier: Fisher Science Education™ S25196
Description
This product is an Educational Grade Chemical — no C of A is available.
Specifications
| Bile Salts | |
| Solid | |
| MFCD00003673 | |
| deoxycholic acid, deoxycholate, desoxycholic acid, choleic acid, cholerebic, cholorebic, degalol, deoxycholatic acid, droxolan, pyrochol | |
| [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C | |
| 392.58 | |
| CHEBI:28834 |
| 83-44-3 | |
| C24H40O4 | |
| 25 g | |
| KXGVEGMKQFWNSR-LLQZFEROSA-N | |
| (4R)-4-[(1R,3aS,3bR,5aR,7R,9aS,9bS,11S,11aR)-7,11-dihydroxy-9a,11a-dimethyl-hexadecahydro-1H-cyclopenta[a]phenanthren-1-yl]pentanoic acid | |
| 222528 | |
| Sodium Salts of Clycoholic and Taurocholic Acids |
Chemical Identifiers
| 83-44-3 | |
| 392.58 | |
| KXGVEGMKQFWNSR-LLQZFEROSA-N | |
| 222528 | |
| (4R)-4-[(1R,3aS,3bR,5aR,7R,9aS,9bS,11S,11aR)-7,11-dihydroxy-9a,11a-dimethyl-hexadecahydro-1H-cyclopenta[a]phenanthren-1-yl]pentanoic acid |
| C24H40O4 | |
| MFCD00003673 | |
| deoxycholic acid, deoxycholate, desoxycholic acid, choleic acid, cholerebic, cholorebic, degalol, deoxycholatic acid, droxolan, pyrochol | |
| CHEBI:28834 | |
| [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C |
Safety and Handling
ShelfLife : 2 years