Learn More
Berberine chloride hydrate, 96%, water <17%
CAS: 141433-60-5 | C20H18ClNO4 | 371.82 g/mol
Supplier: Thermo Scientific Chemicals L0380714
Description
Primarily for the treatment of gastroenteritis, dysentery and other intestinal infections and conjunctivitis, purulent otitis media.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
ApplicationsPrimarily for the treatment of gastroenteritis, dysentery and other intestinal infections and conjunctivitis, purulent otitis media.
Solubility
Soluble in water.
Notes
Light sensitive. Store in the dark. Store away from oxidizing agents, light.
Specifications
| Berberine chloride hydrate | |
| ∽200°C (decomposition) | |
| C20H18ClNO4 | |
| 25 g | |
| Light Sensitive | |
| berberine chloride hydrate, 9,10-dimethoxy-5,6-dihydro-1,3 dioxolo 4,5-g isoquinolino 3,2-a isoquinolin-7-ium chloride hydrate, c20h18no4.cl.h2o, benzo g-1,3-benzodioxolo 5,6-a quinolizinium, 5,6-dihydro-9,10-dimethoxy-, chloride, monohydrate, kyoberin tn, 9,10-dimethoxy-5,6-dihydro-2h-1,3-dioxolano 4,5-g isoquinolino 3,2-a isoquinol ine, chloride, hydrate, berberinechloridehydrate, berberine chloride xhydrate, berberine chloride hydrate jp17 | |
| VKJGBAJNNALVAV-UHFFFAOYSA-M | |
| 16,17-dimethoxy-5,7-dioxa-13λâµ-azapentacyclo[11.8.0.0²,¹â°.0â´,â¸.0¹âµ,²â°]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-13-ylium chloride | |
| 155074 | |
| 97% |
| 141433-60-5 | |
| water <17% | |
| MFCD00011939 | |
| 3836585 | |
| 14,1154 | |
| Soluble in water. | |
| [Cl-].COC1=C(OC)C2=C[N+]3=C(C=C2C=C1)C1=CC2=C(OCO2)C=C1CC3 | |
| 371.82 | |
| 371.82 (Anhydrous) |
Chemical Identifiers
| 141433-60-5 | |
| 371.82 | |
| VKJGBAJNNALVAV-UHFFFAOYSA-M | |
| 155074 | |
| [Cl-].COC1=C(OC)C2=C[N+]3=C(C=C2C=C1)C1=CC2=C(OCO2)C=C1CC3 |
| C20H18ClNO4 | |
| MFCD00011939 | |
| berberine chloride hydrate, 9,10-dimethoxy-5,6-dihydro-1,3 dioxolo 4,5-g isoquinolino 3,2-a isoquinolin-7-ium chloride hydrate, c20h18no4.cl.h2o, benzo g-1,3-benzodioxolo 5,6-a quinolizinium, 5,6-dihydro-9,10-dimethoxy-, chloride, monohydrate, kyoberin tn, 9,10-dimethoxy-5,6-dihydro-2h-1,3-dioxolano 4,5-g isoquinolino 3,2-a isoquinol ine, chloride, hydrate, berberinechloridehydrate, berberine chloride xhydrate, berberine chloride hydrate jp17 | |
| 16,17-dimethoxy-5,7-dioxa-13λâµ-azapentacyclo[11.8.0.0²,¹â°.0â´,â¸.0¹âµ,²â°]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-13-ylium chloride |
Safety and Handling
EINECSNumber : 211-195-9
RTECSNumber : DR9866400
TSCA : Yes
RUO – Research Use Only