Learn More
Benzyl nicotinate, 98%
CAS: 94-44-0 | C13H11NO2 | 213.236 g/mol
$112.62 - $411.32
Chemical Identifiers
| CAS | 94-44-0 |
|---|---|
| Molecular Formula | C13H11NO2 |
| Molecular Weight (g/mol) | 213.236 |
| MDL Number | MFCD00023584 |
| InChI Key | KVYGGMBOZFWZBQ-UHFFFAOYSA-N |
| Synonym | benzyl nicotinate, nicotinic acid benzyl ester, rubriment, pycaril, pykaryl, niacin benzyl ester, 3-pyridinecarboxylic acid, phenylmethyl ester, benzylis nicotinas, nicotinic acid, benzyl ester, nicotinsaeurebenzylester |
| PubChem CID | 7191 |
| ChEBI | CHEBI:31268 |
| IUPAC Name | benzyl pyridine-3-carboxylate |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CN=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1850518
|
Thermo Scientific Chemicals
A1850518 |
50 g |
Each for $112.62
|
|
|||||
|
AAA1850530
|
Thermo Scientific Chemicals
A1850530 |
250 g |
Each for $411.32
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 94-44-0 | |
| 213.236 | |
| KVYGGMBOZFWZBQ-UHFFFAOYSA-N | |
| 7191 | |
| benzyl pyridine-3-carboxylate |
| C13H11NO2 | |
| MFCD00023584 | |
| benzyl nicotinate, nicotinic acid benzyl ester, rubriment, pycaril, pykaryl, niacin benzyl ester, 3-pyridinecarboxylic acid, phenylmethyl ester, benzylis nicotinas, nicotinic acid, benzyl ester, nicotinsaeurebenzylester | |
| CHEBI:31268 | |
| C1=CC=C(C=C1)COC(=O)C2=CN=CC=C2 |
Specifications
| 94-44-0 | |
| 1.165 | |
| 170°C (338°F) | |
| 1.57 | |
| 50 g | |
| 14,6526 | |
| KVYGGMBOZFWZBQ-UHFFFAOYSA-N | |
| benzyl pyridine-3-carboxylate | |
| 7191 | |
| 213.24 | |
| Benzyl nicotinate |
| 21°C to 23°C | |
| 179°C to 180°C (5 mmHg) | |
| C13H11NO2 | |
| MFCD00023584 | |
| 159169 | |
| benzyl nicotinate, nicotinic acid benzyl ester, rubriment, pycaril, pykaryl, niacin benzyl ester, 3-pyridinecarboxylic acid, phenylmethyl ester, benzylis nicotinas, nicotinic acid, benzyl ester, nicotinsaeurebenzylester | |
| C1=CC=C(C=C1)COC(=O)C2=CN=CC=C2 | |
| 213.236 | |
| CHEBI:31268 | |
| 99% |
Safety and Handling
GHS H Statement
H315-H319-H335
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
P264b-P280-P302+P352-P305+P351+P338-P332+P313-P362
H315-H319
EINECSNumber : 202-332-3
RTECSNumber : QT0850000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only