missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzyl Cinnamate 98.0+%, TCI America™
$29.86 - $189.13
Chemical Identifiers
| CAS | 103-41-3 |
|---|---|
| Molecular Formula | C16H14O2 |
| Molecular Weight (g/mol) | 238.29 |
| MDL Number | MFCD00004789,MFCD00004789,MFCD00004789 |
| InChI Key | NGHOLYJTSCBCGC-VAWYXSNFSA-N |
| Synonym | benzyl alcohol cinnamic ester, benzylcinnamate, benzyl alcohol, cinnamate, wln: r1u1vo1r, benzyl .gamma.-phenylacrylate, benzyl cis-cinnamate, benzyl z-cinnamate, 2-propenoic acid, 3-phenyl-, phenylmethyl ester, z-benzyl 3-phenylacrylate, cinnamic acid, benzyl ester, z |
| PubChem CID | 15558051 |
| IUPAC Name | benzyl (2E)-3-phenylprop-2-enoate |
| SMILES | O=C(OCC1=CC=CC=C1)\C=C\C1=CC=CC=C1 |
Chemical Identifiers
| 103-41-3 | |
| 238.29 | |
| NGHOLYJTSCBCGC-VAWYXSNFSA-N | |
| 15558051 | |
| O=C(OCC1=CC=CC=C1)\C=C\C1=CC=CC=C1 |
| C16H14O2 | |
| MFCD00004789,MFCD00004789,MFCD00004789 | |
| benzyl alcohol cinnamic ester, benzylcinnamate, benzyl alcohol, cinnamate, wln: r1u1vo1r, benzyl .gamma.-phenylacrylate, benzyl cis-cinnamate, benzyl z-cinnamate, 2-propenoic acid, 3-phenyl-, phenylmethyl ester, z-benzyl 3-phenylacrylate, cinnamic acid, benzyl ester, z | |
| benzyl (2E)-3-phenylprop-2-enoate |
Specifications
| 103-41-3 | |
| White-Yellow | |
| C16H14O2 | |
| 25 g | |
| NGHOLYJTSCBCGC-VAWYXSNFSA-N | |
| benzyl (2E)-3-phenylprop-2-enoate | |
| 15558051 | |
| ≥98.0% (GC) | |
| Benzyl Cinnamate |
| 36°C | |
| 230°C | |
| MFCD00004789,MFCD00004789,MFCD00004789 | |
| benzyl alcohol cinnamic ester, benzylcinnamate, benzyl alcohol, cinnamate, wln: r1u1vo1r, benzyl .gamma.-phenylacrylate, benzyl cis-cinnamate, benzyl z-cinnamate, 2-propenoic acid, 3-phenyl-, phenylmethyl ester, z-benzyl 3-phenylacrylate, cinnamic acid, benzyl ester, z | |
| O=C(OCC1=CC=CC=C1)\C=C\C1=CC=CC=C1 | |
| 238.29 | |
| 238.29 | |
| Crystals |
Safety and Handling
EINECSNumber : (3)-1739
RTECSNumber : GD8400000
TSCA : Yes