missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzyl cinnamate, 99%
CAS: 103-41-3 | C16H14O2 | 238.29 g/mol
$363.74 - $363.74
Chemical Identifiers
| CAS | 103-41-3 |
|---|---|
| Molecular Formula | C16H14O2 |
| Molecular Weight (g/mol) | 238.29 |
| MDL Number | MFCD00004789,MFCD00004789,MFCD00004789 |
| InChI Key | NGHOLYJTSCBCGC-VAWYXSNFSA-N |
| Synonym | benzyl alcohol cinnamic ester, benzylcinnamate, benzyl alcohol, cinnamate, wln: r1u1vo1r, benzyl .gamma.-phenylacrylate, benzyl cis-cinnamate, benzyl z-cinnamate, 2-propenoic acid, 3-phenyl-, phenylmethyl ester, z-benzyl 3-phenylacrylate, cinnamic acid, benzyl ester, z |
| PubChem CID | 15558051 |
| IUPAC Name | benzyl (Z)-3-phenylprop-2-enoate |
| SMILES | O=C(OCC1=CC=CC=C1)\C=C\C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC215295000
|
Thermo Scientific Chemicals
215295000 |
500 g | Glass bottle |
Each for $363.74
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 103-41-3 | |
| 238.29 | |
| NGHOLYJTSCBCGC-VAWYXSNFSA-N | |
| 15558051 | |
| O=C(OCC1=CC=CC=C1)\C=C\C1=CC=CC=C1 |
| C16H14O2 | |
| MFCD00004789,MFCD00004789,MFCD00004789 | |
| benzyl alcohol cinnamic ester, benzylcinnamate, benzyl alcohol, cinnamate, wln: r1u1vo1r, benzyl .gamma.-phenylacrylate, benzyl cis-cinnamate, benzyl z-cinnamate, 2-propenoic acid, 3-phenyl-, phenylmethyl ester, z-benzyl 3-phenylacrylate, cinnamic acid, benzyl ester, z | |
| benzyl (Z)-3-phenylprop-2-enoate |
Specifications
| 103-41-3 | |
| 100.0 | |
| Colorless to Yellow | |
| >112°C | |
| 98.5% min. (GC) | |
| C16H14O2 | |
| C6H5CH=CHCO2CH2C6H5 | |
| 500 g | |
| 15, 1133 | |
| Solubility in water: practically insoluble. Other solubilities: soluble in alcohol,ether and oils,practically insoluble in propylene glycol and,glycerin | |
| O=C(OCC1=CC=CC=C1)\C=C\C1=CC=CC=C1 | |
| 238.29 | |
| 238.29 | |
| Crystalline Mass or Liquid After Melting |
| 98.5 | |
| 33°C to 37°C | |
| 195°C to 200°C (5.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4025 to 1.4045 | |
| MFCD00004789,MFCD00004789,MFCD00004789 | |
| 09, 584 | |
| benzyl alcohol cinnamic ester, benzylcinnamate, benzyl alcohol, cinnamate, wln: r1u1vo1r, benzyl .gamma.-phenylacrylate, benzyl cis-cinnamate, benzyl z-cinnamate, 2-propenoic acid, 3-phenyl-, phenylmethyl ester, z-benzyl 3-phenylacrylate, cinnamic acid, benzyl ester, z | |
| NGHOLYJTSCBCGC-VAWYXSNFSA-N | |
| benzyl (Z)-3-phenylprop-2-enoate | |
| 15558051 | |
| 99% | |
| Benzyl cinnamate, 99% |
Safety and Handling
EINECSNumber : 203-109-3
RTECSNumber : GD8400000
TSCA : TSCA
RUO – Research Use Only