Learn More
Benzyl 1-piperazinecarboxylate, 97%
CAS: 31166-44-6 | C12H17N2O2 | 221.28 g/mol
Supplier: Thermo Scientific Chemicals 367290250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Benzyl 1-piperazinecarboxylate | |
| 1.1420g/mL | |
| >110°C | |
| Glass bottle | |
| MFCD00274317 | |
| 23,221 | |
| 1-cbz-piperazine, benzyl 1-piperazinecarboxylate, 1-benzyloxycarbonyl piperazine, 1-carbobenzoxypiperazine, n-cbz-piperazine, 1-z-piperazine, 1-piperazinecarboxylic acid, phenylmethyl ester, piperazine-1-carboxylic acid benzyl ester, phenylmethyl piperazinecarboxylate, cbz-piperazine | |
| O=C(OCC1=CC=CC=C1)N1CC[NH2+]CC1 | |
| 221.28 | |
| 220.27 |
| 31166-44-6 | |
| 158.0°C to 161.0°C (1.4 mmHg) | |
| 96% min. (GC) | |
| C12H17N2O2 | |
| 25 g | |
| 1.142 | |
| CTOUWUYDDUSBQE-UHFFFAOYSA-O | |
| benzyl piperazine-1-carboxylate | |
| 643495 | |
| 97% |
Chemical Identifiers
| 31166-44-6 | |
| 221.28 | |
| CTOUWUYDDUSBQE-UHFFFAOYSA-O | |
| 643495 | |
| O=C(OCC1=CC=CC=C1)N1CC[NH2+]CC1 |
| C12H17N2O2 | |
| MFCD00274317 | |
| 1-cbz-piperazine, benzyl 1-piperazinecarboxylate, 1-benzyloxycarbonyl piperazine, 1-carbobenzoxypiperazine, n-cbz-piperazine, 1-z-piperazine, 1-piperazinecarboxylic acid, phenylmethyl ester, piperazine-1-carboxylic acid benzyl ester, phenylmethyl piperazinecarboxylate, cbz-piperazine | |
| benzyl piperazine-1-carboxylate |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
IF
GHS Signal Word: Warning
RUO – Research Use Only