missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzoin, 98%
CAS: 119-53-9 | C14H12O2 | 212.25 g/mol
$64.52 - $154.08
Chemical Identifiers
| CAS | 119-53-9 |
|---|---|
| Molecular Formula | C14H12O2 |
| Molecular Weight (g/mol) | 212.25 |
| MDL Number | MFCD00004496 |
| InChI Key | ISAOCJYIOMOJEB-UHFFFAOYNA-N |
| Synonym | benzoin, 2-hydroxy-2-phenylacetophenone, benzoylphenylcarbinol, benzoin tincture, +--benzoin, ethanone, 2-hydroxy-1,2-diphenyl, bitter almond oil camphor, phenylbenzoyl carbinol, 2-hydroxy-1,2-diphenylethan-1-one, alpha-hydroxybenzyl phenyl ketone |
| PubChem CID | 8400 |
| ChEBI | CHEBI:17682 |
| IUPAC Name | 2-hydroxy-1,2-diphenylethanone |
| SMILES | OC(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC105511000
|
Thermo Scientific Chemicals
105511000 |
100 g | Plastic bottle |
Each for $64.52
|
|
||||
|
AC105515000
|
Thermo Scientific Chemicals
105515000 |
500 g | Plastic bottle |
Each for $154.08
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 119-53-9 | |
| 212.25 | |
| ISAOCJYIOMOJEB-UHFFFAOYNA-N | |
| 8400 | |
| 2-hydroxy-1,2-diphenylethanone |
| C14H12O2 | |
| MFCD00004496 | |
| benzoin, 2-hydroxy-2-phenylacetophenone, benzoylphenylcarbinol, benzoin tincture, +--benzoin, ethanone, 2-hydroxy-1,2-diphenyl, bitter almond oil camphor, phenylbenzoyl carbinol, 2-hydroxy-1,2-diphenylethan-1-one, alpha-hydroxybenzyl phenyl ketone | |
| CHEBI:17682 | |
| OC(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
Specifications
| 119-53-9 | |
| 100.0 | |
| White to Yellow | |
| 1% max. | |
| 97.5% min. (GC) | |
| C14H12O2 | |
| MFCD00004496 | |
| 15, 1095 | |
| Solubility in water: sparingly soluble | |
| OC(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 | |
| 212.25 | |
| CHEBI:17682 | |
| 98% | |
| Benzoin, 98% |
| 97.5 | |
| 133.0°C to 137.0°C | |
| 194.0°C (12.0 mmHg) | |
| Authentic | |
| Plastic bottle | |
| C6H5CH(OH)COC6H5 | |
| 100 g | |
| benzoin, 2-hydroxy-2-phenylacetophenone, benzoylphenylcarbinol, benzoin tincture, +--benzoin, ethanone, 2-hydroxy-1,2-diphenyl, bitter almond oil camphor, phenylbenzoyl carbinol, 2-hydroxy-1,2-diphenylethan-1-one, alpha-hydroxybenzyl phenyl ketone | |
| ISAOCJYIOMOJEB-UHFFFAOYNA-N | |
| 2-hydroxy-1,2-diphenylethanone | |
| 8400 | |
| 212.25 | |
| Powder |
Safety and Handling
EINECSNumber : 204-331-3
RTECSNumber : DI1590000
TSCA : TSCA
RUO – Research Use Only