missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzoin, 98%, ACROS Organics™
$39.42 - $102.32
Chemical Identifiers
| CAS | 119-53-9 |
|---|---|
| Molecular Formula | C14H12O2 |
| Molecular Weight (g/mol) | 212.25 |
| MDL Number | MFCD00004496 |
| InChI Key | ISAOCJYIOMOJEB-UHFFFAOYSA-N |
| Synonym | +--benzoin, 2-hydroxy-1,2-diphenylethan-1-one, 2-hydroxy-2-phenylacetophenone, alpha-hydroxybenzyl phenyl ketone, benzoin, benzoin tincture, benzoylphenylcarbinol, bitter almond oil camphor, ethanone, 2-hydroxy-1,2-diphenyl, phenylbenzoyl carbinol |
| PubChem CID | 8400 |
| ChEBI | CHEBI:17682 |
| IUPAC Name | 2-hydroxy-1,2-diphenylethanone |
| SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC105511000
|
Fisher Scientific Acros
105511000 |
100g | Plastic bottle |
Each for $39.42
|
|
AC105515000
|
Fisher Scientific Acros
105515000 |
500g | Plastic bottle |
Each for $102.32
|
|
AC105510025
|
Thermo Fisher Scientific
AC105510025 |
2.5kg | Plastic bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 119-53-9 | |
| 212.25 | |
| ISAOCJYIOMOJEB-UHFFFAOYSA-N | |
| 8400 | |
| 2-hydroxy-1,2-diphenylethanone |
| C14H12O2 | |
| MFCD00004496 | |
| +--benzoin, 2-hydroxy-1,2-diphenylethan-1-one, 2-hydroxy-2-phenylacetophenone, alpha-hydroxybenzyl phenyl ketone, benzoin, benzoin tincture, benzoylphenylcarbinol, bitter almond oil camphor, ethanone, 2-hydroxy-1,2-diphenyl, phenylbenzoyl carbinol | |
| CHEBI:17682 | |
| C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)O |
Specifications
| Authentic | |
| Plastic bottle | |
| 194.0°C (12.0 mmHg) | |
| 133.0°C to 137.0°C | |
| 119-53-9 | |
| 100.0 | |
| C14H12O2 | |
| MFCD00004496 | |
| +--benzoin, 2-hydroxy-1,2-diphenylethan-1-one, 2-hydroxy-2-phenylacetophenone, alpha-hydroxybenzyl phenyl ketone, benzoin, benzoin tincture, benzoylphenylcarbinol, bitter almond oil camphor, ethanone, 2-hydroxy-1,2-diphenyl, phenylbenzoyl carbinol | |
| ISAOCJYIOMOJEB-UHFFFAOYSA-N | |
| 2-hydroxy-1,2-diphenylethanone | |
| 8400 | |
| 212.25 | |
| 98% |
| 1% max. | |
| 0.2% max. | |
| White to Yellow | |
| 100g | |
| 97.5 | |
| 97.5% min. (GC) | |
| C6H5CH(OH)COC6H5 | |
| 15, 1095 | |
| Solubility in water: sparingly soluble | |
| C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)O | |
| 212.25 | |
| CHEBI:17682 | |
| Powder | |
| Benzoin, 98% |
Safety and Handling
EINECSNumber : 204-331-3
RTECSNumber : DI1590000
TSCA : TSCA