Learn More
Benzil, 99+%
CAS: 134-81-6 | C14H10O2 | 210.23 g/mol
$61.81 - $166.49
Chemical Identifiers
| CAS | 134-81-6 |
|---|---|
| Molecular Formula | C14H10O2 |
| Molecular Weight (g/mol) | 210.23 |
| MDL Number | MFCD00003080 |
| InChI Key | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| Synonym | benzil, diphenylethanedione, dibenzoyl, diphenylglyoxal, bibenzoyl, ethanedione, diphenyl, 1,2-diphenylethanedione, diphenylethane-1,2-dione, glyoxal, diphenyl, diphenyldiketon |
| PubChem CID | 8651 |
| ChEBI | CHEBI:51507 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione |
| SMILES | O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC105411000
|
Thermo Scientific Chemicals
105411000 |
100 g | Plastic bottle |
Each for $61.81
|
|
||||
|
AC105415000
|
Thermo Scientific Chemicals
105415000 |
500 g | Plastic bottle |
Each for $166.49
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 134-81-6 | |
| 210.23 | |
| WURBFLDFSFBTLW-UHFFFAOYSA-N | |
| 8651 | |
| 1,2-diphenylethane-1,2-dione |
| C14H10O2 | |
| MFCD00003080 | |
| benzil, diphenylethanedione, dibenzoyl, diphenylglyoxal, bibenzoyl, ethanedione, diphenyl, 1,2-diphenylethanedione, diphenylethane-1,2-dione, glyoxal, diphenyl, diphenyldiketon | |
| CHEBI:51507 | |
| O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
Specifications
| 134-81-6 | |
| 100.0 | |
| White | |
| 0.5% max. | |
| 99% min. (GC) | |
| C14H10O2 | |
| MFCD00003080 | |
| 15,108 | |
| Solubility in water: 0.5g/L (20°C). Other solubilities: soluble in alcohol,ether,chloroform,ethyl,acetate,benzene,toluene and nitrobenzene | |
| O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 | |
| 210.23 | |
| CHEBI:51507 | |
| 99+% | |
| Benzil, 99+% |
| 99.0 | |
| 94.0°C to 97.0°C | |
| 346.0°C to 348.0°C | |
| Authentic | |
| Plastic bottle | |
| C6H5COCOC6H5 | |
| 100 g | |
| benzil, diphenylethanedione, dibenzoyl, diphenylglyoxal, bibenzoyl, ethanedione, diphenyl, 1,2-diphenylethanedione, diphenylethane-1,2-dione, glyoxal, diphenyl, diphenyldiketon | |
| WURBFLDFSFBTLW-UHFFFAOYSA-N | |
| 1,2-diphenylethane-1,2-dione | |
| 8651 | |
| 210.23 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Causes skin irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attention.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
GHS Signal Word: Warning
EINECSNumber : 205-157-0
RTECSNumber : DD1925000
TSCA : TSCA
RUO – Research Use Only