missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzenesulfinic acid, sodium salt, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 154055000
| Quantity | 500g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C6H5NaO2S | |
| MFCD00013135 | |
| sodium benzenesulfinate, benzenesulfinic acid sodium salt, benzenesulfinic acid, sodium salt, sodium phenylsulfinate, sodium benzenesulphinate, sodium benzene sulfinate, sodiumphenylsulfinate, phso2na, benzenesulfinic acid, sodium salt 1:1, sodium phenylsulphinate | |
| sodium;benzenesulfinate |
Specifications
| Benzenesulfinic acid, sodium salt | |
| 873-55-2 | |
| 100.0 | |
| 97% | |
| C6H5NaO2S | |
| 500g | |
| 11, 2 | |
| sodium benzenesulfinate, benzenesulfinic acid sodium salt, benzenesulfinic acid, sodium salt, sodium phenylsulfinate, sodium benzenesulphinate, sodium benzene sulfinate, sodiumphenylsulfinate, phso2na, benzenesulfinic acid, sodium salt 1:1, sodium phenylsulphinate | |
| C1=CC=C(C=C1)S(=O)[O-].[Na+] | |
| 164.15 | |
| 164.15 |
| 97% | |
| 96.0 | |
| Authentic | |
| Plastic bottle | |
| C6H5SO2Na | |
| MFCD00013135 | |
| 06,526 | |
| CHLCPTJLUJHDBO-UHFFFAOYSA-M | |
| sodium;benzenesulfinate | |
| 2723840 | |
| 97% |
Safety and Handling
EINECSNumber : 212-842-8
TSCA : TSCA