Learn More
Beclomethasone dipropionate, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 460992500
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Beclomethasone dipropionate | |
| 1% max. (105°C, 3 h) | |
| 96% min. (HPLC) | |
| 250mg | |
| KUVIULQEHSCUHY-XYWKZLDCSA-N | |
| [2-[(8R,10S,11S,13S,14S,16S,17R)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate | |
| 134129500 | |
| 97% |
| 5534-09-8 | |
| Authentic | |
| C28H37ClO7 | |
| beclomethasone dipropionate, beclometasone dipropionate, beconase, beclovent, vancenase, beclazone, becloforte, beclomet, beclorhinol, propaderm | |
| CCC(=O)OCC(=O)C1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)Cl)O)C)C)OC(=O)CC | |
| 521.04 | |
| 521.04 |
Chemical Identifiers
| 5534-09-8 | |
| 521.04 | |
| beclomethasone dipropionate, beclometasone dipropionate, beconase, beclovent, vancenase, beclazone, becloforte, beclomet, beclorhinol, propaderm | |
| [2-[(8R,10S,11S,13S,14S,16S,17R)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
| C28H37ClO7 | |
| KUVIULQEHSCUHY-XYWKZLDCSA-N | |
| 134129500 | |
| CCC(=O)OCC(=O)C1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)Cl)O)C)C)OC(=O)CC |
Safety and Handling
GHS H Statement
May damage fertility or the unborn child.
GHS P Statement
Obtain special instructions before use.
Wear protective gloves/protective clothing/eye protection/face protection.
IF exposed or concerned: Get medical advice/attention.
GHS Signal Word: Danger
EINECSNumber : 226-886-
RUO â Research Use Only