missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bathocuproinedisulfonic acid, disodium salt hydrate, 97%
Bathocuproinedisulfonic acid, disodium salt hydrate, 97%, CAS Number-1257642-74-2| C26H18N2Na2O6S2 xH2O | 564.54 g/mol
$270.43 - $1147.60
Chemical Identifiers
| CAS | 1257642-74-2 |
|---|---|
| Molecular Formula | C26H18N2Na2O6S2 |
| Molecular Weight (g/mol) | 564.54 |
| MDL Number | MFCD00149974 |
| InChI Key | RNGKZLRAVYPLJC-UHFFFAOYSA-L |
| Synonym | disodium bathocuproinedisulfonate, sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, bathocuproinedisulfonic acid sodium salt, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate disodium salt, dipotassium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate |
| PubChem CID | 15678335 |
| IUPAC Name | disodium;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate |
| SMILES | [Na+].[Na+].CC1=NC2=C(C=CC3=C2N=C(C)C(=C3C2=CC=CC=C2)S([O-])(=O)=O)C(C2=CC=CC=C2)=C1S([O-])(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC164060010
|
Thermo Scientific Chemicals
164060010 |
1 g | Glass bottle |
Each for $270.43
|
|
||||
|
AC164060050
|
Thermo Scientific Chemicals
164060050 |
5 g | Glass bottle |
Each for $1,147.60
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1257642-74-2 | |
| 564.54 | |
| RNGKZLRAVYPLJC-UHFFFAOYSA-L | |
| 15678335 | |
| [Na+].[Na+].CC1=NC2=C(C=CC3=C2N=C(C)C(=C3C2=CC=CC=C2)S([O-])(=O)=O)C(C2=CC=CC=C2)=C1S([O-])(=O)=O |
| C26H18N2Na2O6S2 | |
| MFCD00149974 | |
| disodium bathocuproinedisulfonate, sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, bathocuproinedisulfonic acid sodium salt, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate disodium salt, dipotassium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| disodium;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate |
Specifications
| 1257642-74-2 | |
| disulfonate) (HPLC) | |
| C26H18N2Na2O6S2 | |
| 1 g | |
| Solubility in water: soluble in water | |
| [Na+].[Na+].CC1=NC2=C(C=CC3=C2N=C(C)C(=C3C2=CC=CC=C2)S([O-])(=O)=O)C(C2=CC=CC=C2)=C1S([O-])(=O)=O | |
| 564.54 | |
| 564.54 | |
| Bathocuproinedisulfonic acid, disodium salt hydrate |
| 300.0°C | |
| Glass bottle | |
| MFCD00149974 | |
| disodium bathocuproinedisulfonate, sodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, bathocuproinedisulfonic acid sodium salt, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate, 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline disulfonate disodium salt, dipotassium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate, disodium 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| RNGKZLRAVYPLJC-UHFFFAOYSA-L | |
| disodium;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate | |
| 15678335 | |
| 97% |
Safety and Handling
EINECSNumber : 258-111-7
RUO – Research Use Only