Learn More
Thermo Scientific Chemicals Basic Fuchsin, 70+%, pure
CAS: 632-99-5 | C20H20ClN3 | 337.85 g/mol
Supplier: Thermo Scientific Chemicals 401691000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Basic Fuchsin | |
| Pure | |
| 1.16 to 1.35 | |
| C20H20ClN3 | |
| 13, 765 | |
| Basic Violet 14, hydrochloride, C.I. 42510, Rosaniline chloride | |
| AXDJCCTWPBKUKL-UHFFFAOYSA-N | |
| [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1 | |
| 337.85 | |
| 547 to 552nm | |
| ≥70% | |
| Glass bottle | |
| Green | |
| 200°C |
| 250.0°C | |
| 632-99-5 | |
| 70% min. | |
| MFCD00012569 | |
| 15, 5715 | |
| Solubility in water: 4g/L (25°C). Other solubilities: soluble in alcohol and acids, practically insoluble in ether, soluble 30g/L in ethanol (25°C) | |
| Authentic | |
| 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride | |
| 12447 | |
| 337.84 | |
| Pure | |
| 200g/mL | |
| 100 g | |
| Glistening Crystalline Powder |
Chemical Identifiers
| 632-99-5 | |
| 337.85 | |
| AXDJCCTWPBKUKL-UHFFFAOYSA-N | |
| 12447 | |
| [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1 |
| C20H20ClN3 | |
| MFCD00012569 | |
| Basic Violet 14, hydrochloride, C.I. 42510, Rosaniline chloride | |
| 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride |
Safety and Handling
GHS H Statement
Suspected of causing cancer. Harmful if swallowed.
GHS P Statement
Use personal protective equipment as required. IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Warning
RUO – Research Use Only