missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Barium acetate, Puriss. p.a., ACS Reagent, ≥99%, Honeywell Fluka™
Puriss. p.a., ACS Reagent,≥99%
Supplier: Honeywell Chemicals 323051KG
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Barium Acetate | |
| 1 kg | |
| (CH3COO)2Ba | |
| NONH for all modes of transport | |
| barium acetate, barium diacetate, acetic acid, barium salt, octan barnaty, barium di acetate, caswell no. 068a, octan barnaty czech, unii-fba31yj60r, ccris 7240, barium 2+ diacetate | |
| [Ba++].CC([O-])=O.CC([O-])=O | |
| 255.42 | |
| 255.42g/mol | |
| ACS/puriss. p.a. |
| 543-80-6 | |
| C4H6BaO4 | |
| MFCD00012447 | |
| 3693411 | |
| ITHZDDVSAWDQPZ-UHFFFAOYSA-L | |
| barium(2+);diacetate | |
| 10980 | |
| ≥99% |
Chemical Identifiers
| 543-80-6 | |
| 255.42 | |
| ITHZDDVSAWDQPZ-UHFFFAOYSA-L | |
| 10980 |
| C4H6BaO4 | |
| MFCD00012447 | |
| barium acetate, barium diacetate, acetic acid, barium salt, octan barnaty, barium di acetate, caswell no. 068a, octan barnaty czech, unii-fba31yj60r, ccris 7240, barium 2+ diacetate | |
| [Ba++].CC([O-])=O.CC([O-])=O |
Safety and Handling
P261-P301 + P312 + P330
H302 + H332
EINECSNumber : 208-849-0