Learn More
Azoxybenzene, 98+%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals B2002109
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Azoxybenzene | |
| 33°C to 36°C | |
| 130°C (0.9 mmHg) | |
| MFCD00019925 | |
| 743984 | |
| azoxybenzene, azoxybenzide, azoxybenzol, fenazox, fentoxan, azobenzene, oxide, diphenyldiazene 1-oxide, benzene, azoxydi, diazene, diphenyl-, 1-oxide, ordinary azoxybenzene | |
| C1=CC=C(C=C1)N=[N+](C2=CC=CC=C2)[O-] | |
| 198.225 | |
| CHEBI:51865 | |
| ≥98% |
| 495-48-7 | |
| 1.16 | |
| C12H10N2O | |
| 10 g | |
| 14,923 | |
| GAUZCKBSTZFWCT-UHFFFAOYSA-N | |
| oxido-phenyl-phenyliminoazanium | |
| 10316 | |
| 198.23 |
Chemical Identifiers
| 495-48-7 | |
| 198.225 | |
| GAUZCKBSTZFWCT-UHFFFAOYSA-N | |
| 10316 | |
| oxido-phenyl-phenyliminoazanium |
| C12H10N2O | |
| MFCD00019925 | |
| azoxybenzene, azoxybenzide, azoxybenzol, fenazox, fentoxan, azobenzene, oxide, diphenyldiazene 1-oxide, benzene, azoxydi, diazene, diphenyl-, 1-oxide, ordinary azoxybenzene | |
| CHEBI:51865 | |
| C1=CC=C(C=C1)N=[N+](C2=CC=CC=C2)[O-] |
Safety and Handling
GHS H Statement
H302-H312-H332
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
P261-P264b-P270-P271-P301+P312-P304+P340-P312-P330-P501c
H302+H332
EINECSNumber : 207-802-1
RTECSNumber : CO4025000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only