missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Aspartame, Powder, NF, 98-102%, Spectrum™ Chemical
A1378, 22839-47-0, C14H18N2O5
Supplier: Spectrum Chemical Mfg Cor A137812KGBL
Description
Spectrum™ Chemical Aspartame, Powder, NF is used in pharmaceutical products, often as a sugar replacement in chewable tablets and sugar-free liquids. Spectrum Chemical NF products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 22839-47-0 | |
| 0.2% | |
| C14H18N2O5 | |
| MFCD00002724 | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| (3S)-3-amino-3-{[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl}propanoic acid | |
| 294.31 | |
| NF |
| 100% | |
| 4.5% | |
| Fiber Drum | |
| +14.5 to +16.5° | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O | |
| 12 kg | |
| 98 to 102% |
Chemical Identifiers
| 22839-47-0 | |
| 294.31 | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O |
| C14H18N2O5 | |
| MFCD00002724 | |
| (3S)-3-amino-3-{[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl}propanoic acid |