missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Arbutin, 98%
CAS: 497-76-7 | C12H16O7 | 272.25 g/mol
Supplier: Thermo Scientific Chemicals 455640050
| Quantity | 5 g |
|---|
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 497-76-7 | |
| 272.25 | |
| BJRNKVDFDLYUGJ-UHFFFAOYNA-N | |
| 440936 | |
| (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol |
| C12H16O7 | |
| MFCD00016915 | |
| arbutin, uvasol, 4-hydroxyphenyl beta-d-glucopyranoside, ursin, beta-arbutin, arbutoside, arbutine, arbutyne, ursi, p-arbutin | |
| CHEBI:18305 | |
| OCC1OC(OC2=CC=C(O)C=C2)C(O)C(O)C1O |
Specifications
| Arbutin | |
| 195.0°C to 201.0°C | |
| Authentic | |
| C12H16O7 | |
| MFCD00016915 | |
| Solubility in water: 50g/L. Other solubilities: soluble in alcohols | |
| OCC1OC(OC2=CC=C(O)C=C2)C(O)C(O)C1O | |
| 272.25 | |
| CHEBI:18305 | |
| 98% |
| 497-76-7 | |
| 2% max. | |
| 97.5% min. (HPLC) | |
| 5 g | |
| arbutin, uvasol, 4-hydroxyphenyl beta-d-glucopyranoside, ursin, beta-arbutin, arbutoside, arbutine, arbutyne, ursi, p-arbutin | |
| BJRNKVDFDLYUGJ-UHFFFAOYNA-N | |
| (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol | |
| 440936 | |
| 272.25 |
Safety and Handling
EINECSNumber : 207-850-3