Learn More
Antipyrine, 99%
CAS: 60-80-0 | C11H12N2O | 188.23 g/mol
$71.78 - $219.00
Chemical Identifiers
| CAS | 60-80-0 |
|---|---|
| Molecular Formula | C11H12N2O |
| Molecular Weight (g/mol) | 188.23 |
| MDL Number | MFCD00003146 |
| InChI Key | VEQOALNAAJBPNY-UHFFFAOYSA-N |
| Synonym | antipyrine, phenazone, antipyrin, phenazon, analgesine, anodynine, anodynin, azophen, fenazone, 2,3-dimethyl-1-phenyl-5-pyrazolone |
| PubChem CID | 2206 |
| ChEBI | CHEBI:31225 |
| IUPAC Name | 1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CC1=CC(=O)N(N1C)C2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC104971000
|
Thermo Scientific Chemicals
104971000 |
100 g |
Each for $71.78
|
|
|||||
|
AC104975000
|
Thermo Scientific Chemicals
104975000 |
500 g |
Each for $219.00
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 60-80-0 | |
| 188.23 | |
| VEQOALNAAJBPNY-UHFFFAOYSA-N | |
| 2206 | |
| 1,5-dimethyl-2-phenylpyrazol-3-one |
| C11H12N2O | |
| MFCD00003146 | |
| antipyrine, phenazone, antipyrin, phenazon, analgesine, anodynine, anodynin, azophen, fenazone, 2,3-dimethyl-1-phenyl-5-pyrazolone | |
| CHEBI:31225 | |
| CC1=CC(=O)N(N1C)C2=CC=CC=C2 |
Specifications
| 60-80-0 | |
| White | |
| Authentic | |
| Plastic bottle | |
| MFCD00003146 | |
| 24,27 | |
| antipyrine, phenazone, antipyrin, phenazon, analgesine, anodynine, anodynin, azophen, fenazone, 2,3-dimethyl-1-phenyl-5-pyrazolone | |
| VEQOALNAAJBPNY-UHFFFAOYSA-N | |
| 1,5-dimethyl-2-phenylpyrazol-3-one | |
| 2206 | |
| 188.23 | |
| Crystalline Powder |
| 109°C to 113°C | |
| 319°C | |
| 98.5% min. (Iodimetry) | |
| C11H12N2O | |
| 100 g | |
| 15,703 | |
| Solubility in water: 1000g/L (20°C). Other solubilities: soluble in alcohol and chloroform,slightly soluble in ether | |
| CC1=CC(=O)N(N1C)C2=CC=CC=C2 | |
| 188.23 | |
| CHEBI:31225 | |
| 99% | |
| Antipyrine, 99% |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye prot
GHS Signal Word: Warning
EINECSNumber : 200-486-6
RTECSNumber : CD2450000
TSCA : TSCA
RUO – Research Use Only