missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Anisoin, 95%
CAS: 119-52-8 | C16H16O4 | 272.30 g/mol
$251.26 - $251.26
Chemical Identifiers
| CAS | 119-52-8 |
|---|---|
| Molecular Formula | C16H16O4 |
| Molecular Weight (g/mol) | 272.30 |
| MDL Number | MFCD00008411 |
| InChI Key | LRRQSCPPOIUNGX-UHFFFAOYNA-N |
| Synonym | anisoin, 2-hydroxy-1,2-bis 4-methoxyphenyl ethanone, 4,4'-dimethoxybenzoin, p-anisoin, ethanone, 2-hydroxy-1,2-bis 4-methoxyphenyl, benzoin, 4,4'-dimethoxy, p,p'-dimethoxybenzoin, benzoin,4'-dimethoxy, 4,4'-anisoin, 1,2-bis 4-methoxyphenyl-2-hydroxyethan-1-one |
| PubChem CID | 95415 |
| IUPAC Name | 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone |
| SMILES | COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC104841000
|
Thermo Scientific Chemicals
104841000 |
100 g | Plastic bottle |
Each for $251.26
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 119-52-8 | |
| 272.30 | |
| LRRQSCPPOIUNGX-UHFFFAOYNA-N | |
| 95415 | |
| COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1 |
| C16H16O4 | |
| MFCD00008411 | |
| anisoin, 2-hydroxy-1,2-bis 4-methoxyphenyl ethanone, 4,4'-dimethoxybenzoin, p-anisoin, ethanone, 2-hydroxy-1,2-bis 4-methoxyphenyl, benzoin, 4,4'-dimethoxy, p,p'-dimethoxybenzoin, benzoin,4'-dimethoxy, 4,4'-anisoin, 1,2-bis 4-methoxyphenyl-2-hydroxyethan-1-one | |
| 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone |
Specifications
| 119-52-8 | |
| Beige to Yellow | |
| 94% min. (HPLC) | |
| C16H16O4 | |
| 100 g | |
| anisoin, 2-hydroxy-1,2-bis 4-methoxyphenyl ethanone, 4,4'-dimethoxybenzoin, p-anisoin, ethanone, 2-hydroxy-1,2-bis 4-methoxyphenyl, benzoin, 4,4'-dimethoxy, p,p'-dimethoxybenzoin, benzoin,4'-dimethoxy, 4,4'-anisoin, 1,2-bis 4-methoxyphenyl-2-hydroxyethan-1-one | |
| COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1 | |
| 272.30 | |
| 272.29 | |
| Powder |
| 109°C to 114°C | |
| Authentic | |
| Plastic bottle | |
| MFCD00008411 | |
| 08, 423 | |
| LRRQSCPPOIUNGX-UHFFFAOYNA-N | |
| 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone | |
| 95415 | |
| 95% | |
| Anisoin, 95% |
Safety and Handling
EINECSNumber : 204-330-8
TSCA : TSCA
RUO – Research Use Only