missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Aniline Blue, sodium salt, pure, water soluble, certified
CAS: 28983-56-4 | C37H26N3Na2O9S3 | 798.79 g/mol
Supplier: Thermo Scientific Chemicals 401180250
| Quantity | 25 g |
|---|
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 28983-56-4 | |
| 798.79 | |
| TUHAIJABPUJAEY-UHFFFAOYSA-K | |
| 131675892 | |
| [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O |
| C37H26N3Na2O9S3 | |
| MFCD00058509 | |
| Acid Blue 22, C.I. 42755 | |
| disodium 2-{[4-({4-[(2-sulfonatophenyl)amino]phenyl}({4-[(2-sulfonatophenyl)imino]cyclohexa-2,5-dien-1-ylidene})methyl)phenyl]amino}benzene-1-sulfonate |
Specifications
| Aniline Blue, sodium salt | |
| 0.96 to 1.09 | |
| C37H26N3Na2O9S3 | |
| Acid Blue 22, C.I. 42755 | |
| [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O | |
| disodium 2-{[4-({4-[(2-sulfonatophenyl)amino]phenyl}({4-[(2-sulfonatophenyl)imino]cyclohexa-2,5-dien-1-ylidene})methyl)phenyl]amino}benzene-1-sulfonate | |
| 131675892 | |
| 737.71 | |
| Pure | |
| Vapor Pressure: Negligible | |
| 25 g |
| 28983-56-4 | |
| 12.0mL of 0.1N TiCl3/g min. | |
| MFCD00058509 | |
| TUHAIJABPUJAEY-UHFFFAOYSA-K | |
| Authentic | |
| 798.79 | |
| 594 to 610nm | |
| 12.0 mL of 0.1 N TiCl3/g min. | |
| Glass bottle | |
| Brown/Purple | |
| Crystalline Powder |
Safety and Handling
GHS H Statement:
Causes skin irritation.
May cause respiratory irritation.
Causes serious eye irritation.
Emergency Overview
Irritating to eyes, respiratory system and skin.
NFPA
Health:2 Flammability:0 Instability:0
Signal Word: WARNING!