Learn More
Aniline-2-sulfonic Acid, 95%
CAS: 88-21-1 | C6H7NO3S | 173.19 g/mol
$55.43 - $55.43
Chemical Identifiers
| CAS | 88-21-1 |
|---|---|
| Molecular Formula | C6H7NO3S |
| Molecular Weight (g/mol) | 173.19 |
| MDL Number | MFCD00007705 |
| InChI Key | ZMCHBSMFKQYNKA-UHFFFAOYSA-N |
| Synonym | orthanilic acid, aniline-2-sulfonic acid, o-aminobenzenesulfonic acid, o-sulfanilic acid, aniline-o-sulfonic acid, 2-sulfanilic acid, aniline-o-sulphonic acid, 1-aminobenzene-2-sulfonic acid, 2-aminobenzenesulphonic acid, benzenesulfonic acid, 2-amino |
| PubChem CID | 6926 |
| ChEBI | CHEBI:1015 |
| IUPAC Name | 2-aminobenzenesulfonic acid |
| SMILES | C1=CC=C(C(=C1)N)S(=O)(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC400640250
|
Thermo Scientific Chemicals
400640250 |
25 g | Glass bottle |
Each for $55.43
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 88-21-1 | |
| 173.19 | |
| ZMCHBSMFKQYNKA-UHFFFAOYSA-N | |
| 6926 | |
| 2-aminobenzenesulfonic acid |
| C6H7NO3S | |
| MFCD00007705 | |
| orthanilic acid, aniline-2-sulfonic acid, o-aminobenzenesulfonic acid, o-sulfanilic acid, aniline-o-sulfonic acid, 2-sulfanilic acid, aniline-o-sulphonic acid, 1-aminobenzene-2-sulfonic acid, 2-aminobenzenesulphonic acid, benzenesulfonic acid, 2-amino | |
| CHEBI:1015 | |
| C1=CC=C(C(=C1)N)S(=O)(=O)O |
Specifications
| 88-21-1 | |
| White to Beige | |
| 95% | |
| C6H7NO3S | |
| MFCD00007705 | |
| 14, 681 | |
| orthanilic acid, aniline-2-sulfonic acid, o-aminobenzenesulfonic acid, o-sulfanilic acid, aniline-o-sulfonic acid, 2-sulfanilic acid, aniline-o-sulphonic acid, 1-aminobenzene-2-sulfonic acid, 2-aminobenzenesulphonic acid, benzenesulfonic acid, 2-amino | |
| ZMCHBSMFKQYNKA-UHFFFAOYSA-N | |
| 2-aminobenzenesulfonic acid | |
| 6926 | |
| 173.19 | |
| Crystalline Powder |
| >300°C | |
| Authentic | |
| Glass bottle | |
| H2NC6H4SO3H | |
| 25 g | |
| 15, 6978 | |
| Solubility in water: 3100mg/l (23°C) | |
| C1=CC=C(C(=C1)N)S(=O)(=O)O | |
| 173.19 | |
| CHEBI:1015 | |
| 95% | |
| Aniline-2-sulfonic acid |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Immediately
GHS Signal Word: Danger
EINECSNumber : 201-810-9
RUO – Research Use Only