missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Anhydrous Citric Acid, Granular, USP, 99.5-100.5%, Spectrum™ Chemical
CI133, 77-92-9, C6H8O7
Supplier: Spectrum Chemical Mfg Cor CI13345KGBL
Description
Spectrum™ Chemical Anhydrous Citric Acid, Granular, USP belongs to a class of drugs known as urinary alkalinizers that are used to treat certain metabolic problems (acidosis) caused by kidney disease. All Spectrum Chemical USP grade products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 77-92-9 | |
| C6H8O7 | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid | |
| 99.5 to 100.5% | |
| 45 kg | |
| Fiber Drum |
| 100% | |
| MFCD00011669 | |
| OC(=O)CC(O)(CC(O)=O)C(O)=O | |
| 192.12 | |
| USP | |
| 0.1% |
Chemical Identifiers
| 77-92-9 | |
| 192.12 | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| OC(=O)CC(O)(CC(O)=O)C(O)=O |
| C6H8O7 | |
| MFCD00011669 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid |