Learn More
Amorolfine hydrochloride, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 458750010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Amorolfine hydrochloride | |
| Authentic | |
| Glass Bottle | |
| 1g | |
| Solubility in water: 9g/L. Other solubilities: 28 mg/mL dmso, 71 mg/mL ethanol | |
| CCC(C)(C)C1=CC=C(C=C1)CC(C)CN2CC(OC(C2)C)C.Cl | |
| 353.97 | |
| CHEBI:59649 | |
| 98% |
| 78613-38-4 | |
| 98.5% min. (HPLC) | |
| C21H35NO·HCl | |
| amorolfine hydrochloride, amorolfine hcl, loceryl, curanail, locetar, odenil, amorolfin, pekiron, amorolfine hydrochloride jan | |
| XZKWIPVTHGWDCF-KUZYQSSXSA-N | |
| (2R,6S)-2,6-dimethyl-4-[2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl]morpholine;hydrochloride | |
| 54259 | |
| 353.97 |
Chemical Identifiers
| 78613-38-4 | |
| 353.97 | |
| amorolfine hydrochloride, amorolfine hcl, loceryl, curanail, locetar, odenil, amorolfin, pekiron, amorolfine hydrochloride jan | |
| CHEBI:59649 | |
| CCC(C)(C)C1=CC=C(C=C1)CC(C)CN2CC(OC(C2)C)C.Cl |
| C21H35NO·HCl | |
| XZKWIPVTHGWDCF-KUZYQSSXSA-N | |
| 54259 | |
| (2R,6S)-2,6-dimethyl-4-[2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl]morpholine;hydrochloride |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Toxic to aquatic life with long lasting effects.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
Take off contaminated clothing and wash before re
GHS Signal Word: Warning
RUO â Research Use Only