missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ammonium sulfate, 99%, for biochemistry, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 447135000
| Quantity | 500g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 7783-20-2 | |
| 132.14 | |
| ammonium sulfate, diammonium sulfate, ammonium sulphate, mascagnite, sulfuric acid diammonium salt, ammonium sulfate 2:1, ammoniumsulfate, actamaster, sulfuric acid, diammonium salt, diammonium sulphate | |
| CHEBI:62946 | |
| [NH4+].[NH4+].[O-]S(=O)(=O)[O-] |
| H8N2O4S | |
| BFNBIHQBYMNNAN-UHFFFAOYSA-N | |
| 6097028 | |
| diazanium;sulfate |
Specifications
| Ammonium sulfate | |
| 500g | |
| (NH4)2SO4 | |
| ammonium sulfate, diammonium sulfate, ammonium sulphate, mascagnite, sulfuric acid diammonium salt, ammonium sulfate 2:1, ammoniumsulfate, actamaster, sulfuric acid, diammonium salt, diammonium sulphate | |
| BFNBIHQBYMNNAN-UHFFFAOYSA-N | |
| diazanium;sulfate | |
| 6097028 | |
| 132.14 | |
| Biochemistry |
| 7783-20-2 | |
| H8N2O4S | |
| 15,552 | |
| Solubility in water: 754g/L. Other solubilities: insoluble in alcohol and acetone | |
| [NH4+].[NH4+].[O-]S(=O)(=O)[O-] | |
| 132.14 | |
| CHEBI:62946 | |
| 99% |
Safety and Handling
EINECSNumber : 231-984-1