missing translation for 'onlineSavingsMsg'
Learn More
Learn More
.png-650.jpg)
Ammonium persulfate, 98+%, ACS reagent
Oxidation reagent | CAS: 7727-54-0 | H8N2O8S2 | 228.19 g/mol
$112.63 - $2289.94
Chemical Identifiers
| CAS | 7727-54-0 |
|---|---|
| Molecular Formula | H8N2O8S2 |
| Molecular Weight (g/mol) | 228.19 |
| MDL Number | MFCD00003390 |
| InChI Key | ROOXNKNUYICQNP-UHFFFAOYSA-N |
| Synonym | ammonium persulfate, ammonium peroxydisulfate, diammonium peroxydisulfate, diammonium persulfate, ammoniumpersulfate, diammonium peroxodisulphate, diammonium peroxydisulphate, unii-22qf6l357f, ccris 1430, persulfate d'ammonium french |
| PubChem CID | 62648 |
| IUPAC Name | diazanium;sulfonatooxy sulfate |
| SMILES | [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC401160100
|
Thermo Scientific Chemicals
401160100 |
10 g | Glass Bottle |
Each for $114.08
|
|
||||
|
AC401161000
|
Thermo Scientific Chemicals
401161000 |
100 g | Plastic bottle |
Each for $112.63
Case of 6 Each for $675.78
|
|
||||
|
AC401165000
|
Thermo Scientific Chemicals
401165000 |
500 g | Plastic bottle |
Each for $133.71
Case of 6 Each for $802.26
|
|
||||
|
AC401160020
|
Thermo Scientific Chemicals
401160020 |
2 kg | Glass bottle |
Each for $189.91
|
|
||||
|
AC401160050
|
Thermo Scientific Chemicals
401160050 |
5 kg | Plastic Bottle |
Each for $465.96
|
|
||||
|
AC401160250
|
Thermo Scientific Chemicals
401160250 |
25 kg | Fibre drum |
Each for $2,289.94
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Suitable for battery materials development.
Oxidation reagentChemical Identifiers
| 7727-54-0 | |
| 228.19 | |
| ROOXNKNUYICQNP-UHFFFAOYSA-N | |
| 62648 | |
| [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O |
| H8N2O8S2 | |
| MFCD00003390 | |
| ammonium persulfate, ammonium peroxydisulfate, diammonium peroxydisulfate, diammonium persulfate, ammoniumpersulfate, diammonium peroxodisulphate, diammonium peroxydisulphate, unii-22qf6l357f, ccris 1430, persulfate d'ammonium french | |
| diazanium;sulfonatooxy sulfate |
Specifications
| 120.0°C | |
| White | |
| 10 g | |
| H8N2O8S2 | |
| MFCD00003390 | |
| 15, 539 | |
| ROOXNKNUYICQNP-UHFFFAOYSA-N | |
| diazanium;sulfonatooxy sulfate | |
| 62648 | |
| ≥98% | |
| Glass Bottle | |
| 1.98 | |
| >120°C | |
| Ammonium persulfate |
| 7727-54-0 | |
| Crystalline Powder and/or Crystals | |
| 98+% | |
| (NH4)2S2O8 | |
| 01,952; 02,348; 03,238; 05,15; 06,20; 12,33 | |
| ammonium persulfate, ammonium peroxydisulfate, diammonium peroxydisulfate, diammonium persulfate, ammoniumpersulfate, diammonium peroxodisulphate, diammonium peroxydisulphate, unii-22qf6l357f, ccris 1430, persulfate d'ammonium french | |
| [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O | |
| 228.19 | |
| 228.19 | |
| ACS Reagent | |
| 0.05% max. | |
| Negligible | |
| 1.9800g/mL |
Safety and Handling
GHS H Statement
May cause allergy or asthma symptoms or breathing difficulties if inhaled.
May cause respiratory irritation.
Causes skin irritation.
May cause an allergic skin reaction.
Causes serious eye irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Take any precaution to avoid mixing with combustibles.
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation or rash occurs.
GHS Signal Word: Danger
EINECSNumber : 231-786-5
RUO – Research Use Only