missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ammonium Peroxydisulfate, Crystal, BiotechGrade, 98%, Spectrum™ Chemical
A1227, 7727-54-0, (NH4)2S2O8
Supplier: Spectrum Chemical Mfg Cor A122712KGBL
Description
Spectrum™ Chemical Ammonium Peroxydisulfate, Crystal, BiotechGrade this highly water soluble oxidizing agent is a catalyst for acrylamide gel polymerization when used in conjunction with Tetramethylethylenediamine. Spectrum offers highly pure reagents suitable for biochemical research and analysis. The critical parameters involved are absence of inhibitors such as traces of heavy metals as well as biochemical function tests for enzymes, coenzymes and enzyme substrates.Specifications
| 7727-54-0 | |
| 12 kg | |
| MFCD00003390 | |
| ROOXNKNUYICQNP-UHFFFAOYSA-N | |
| diammonium [(sulfonatoperoxy)sulfonyl]oxidanide | |
| 98% | |
| Poly Pail | |
| Colorless to white |
| 100% | |
| H8N2O8S2 | |
| UN1444 | |
| [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O | |
| 228.19 | |
| Biotech | |
| 0.05% |
Chemical Identifiers
| 7727-54-0 | |
| 228.19 | |
| ROOXNKNUYICQNP-UHFFFAOYSA-N | |
| [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O |
| H8N2O8S2 | |
| MFCD00003390 | |
| diammonium [(sulfonatoperoxy)sulfonyl]oxidanide |