missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ Alpha-D-Galactose-1-phosphate, Dipotassium Salt, Calbiochem™,
Free of glucose-1-phosphate and related sugar nucleotides that tend to contaminate isolated material
Supplier: MilliporeSigma™ 345646100MG
Specifications
| Alpha-D-Galactose-1-phosphate | |
| 100 g | |
| ≥99% | |
| MFCD00065475 | |
| Easily soluble in cold water | |
| [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O | |
| 336.32 | |
| 336.3 |
| 19046-60-7 | |
| by titration | |
| C6H11K2O9P | |
| alpha-d-galactose-1-phosphate dipotassium salt dihydrate | |
| KCIDZIIHRGYJAE-YGFYJFDDSA-L | |
| dipotassium (2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl phosphate | |
| 131875454 |
Chemical Identifiers
| 19046-60-7 | |
| 336.32 | |
| KCIDZIIHRGYJAE-YGFYJFDDSA-L | |
| 131875454 | |
| [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O |
| C6H11K2O9P | |
| MFCD00065475 | |
| alpha-d-galactose-1-phosphate dipotassium salt dihydrate | |
| dipotassium (2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl phosphate |
Safety and Handling
EINECSNumber : 242-783-3
Recommended Storage : Keep container tightly closed. Keep container in a cool, well-ventilated area. Do not store above -20°C (-4°F).