Learn More
alpha-Benzoin oxime, 98%
CAS: 441-38-3 | C14H13NO2 | 227.26 g/mol
Supplier: Thermo Scientific Chemicals 105530250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| α-Benzoin oxime | |
| 97.5 | |
| 150°C to 155°C | |
| Authentic | |
| Glass bottle | |
| C6H5CH(OH)C(=NOH)C6H5 | |
| 25 g | |
| 15,1096 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in alcohol,aq. ammonium hydroxide | |
| O\N=C(\C(O)C1=CC=CC=C1)C1=CC=CC=C1 | |
| 227.26 | |
| 227.26 | |
| Crystalline Powder |
| 441-38-3 | |
| 100.0 | |
| White | |
| 97.5% min. (HPLC) | |
| C14H13NO2 | |
| MFCD00004501 | |
| 08,IV,1282 | |
| 2-hydroxy-1,2-diphenylethanone oxime, e,alphar-benzoinoxime, 2r-2-hydroxy-1,2-diphenylethanone oxime, 1r,2z-2-hydroxyimino-1,2-diphenylethanol, 1r,2z-2-hydroxyimino-1,2-diphenyl-ethanol, unii-ptc1433kj8 component | |
| WAKHLWOJMHVUJC-FYWRMAATNA-N | |
| (1R,2Z)-2-hydroxyimino-1,2-diphenylethanol | |
| 7057888 | |
| 98% |
Chemical Identifiers
| 441-38-3 | |
| 227.26 | |
| WAKHLWOJMHVUJC-FYWRMAATNA-N | |
| 7057888 | |
| O\N=C(\C(O)C1=CC=CC=C1)C1=CC=CC=C1 |
| C14H13NO2 | |
| MFCD00004501 | |
| 2-hydroxy-1,2-diphenylethanone oxime, e,alphar-benzoinoxime, 2r-2-hydroxy-1,2-diphenylethanone oxime, 1r,2z-2-hydroxyimino-1,2-diphenylethanol, 1r,2z-2-hydroxyimino-1,2-diphenyl-ethanol, unii-ptc1433kj8 component | |
| (1R,2Z)-2-hydroxyimino-1,2-diphenylethanol |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
GHS Signal Word: Warning
EINECSNumber : 207-127-2
RUO – Research Use Only