Learn More
Thermo Scientific Chemicals AEBSF hydrochloride, 98%
CAS: 30827-99-7 | C8H10FNO2S·ClH | 239.7 g/mol
$164.26 - $1497.42
Chemical Identifiers
| CAS | 30827-99-7 |
|---|---|
| Molecular Formula | C8H10FNO2S·ClH |
| Molecular Weight (g/mol) | 239.7 |
| MDL Number | MFCD00132962 |
| InChI Key | WRDABNWSWOHGMS-UHFFFAOYSA-N |
| Synonym | 4-2-aminoethyl benzenesulfonyl fluoride hydrochloride, aebsf, aebsf hydrochloride, pefabloc sc, aebsf hcl, pefabloc, 4-2-aminoethyl benzene-1-sulfonyl fluoride hydrochloride, aebsf, hydrochloride, benzenesulfonyl fluoride, 4-2-aminoethyl-, hydrochloride, 4-2-aminoethyl benzenesulfonylfluoride hydrochloride |
| PubChem CID | 186136 |
| IUPAC Name | 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride |
| SMILES | C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC328110500
|
Thermo Scientific Chemicals
328110500 |
50 mg | Glass bottle |
Each for $164.26
|
|
||||
|
AC328110010
|
Thermo Scientific Chemicals
328110010 |
1 g | Glass bottle |
Each for $1,497.42
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 30827-99-7 | |
| 239.7 | |
| WRDABNWSWOHGMS-UHFFFAOYSA-N | |
| 186136 | |
| C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl |
| C8H10FNO2S·ClH | |
| MFCD00132962 | |
| 4-2-aminoethyl benzenesulfonyl fluoride hydrochloride, aebsf, aebsf hydrochloride, pefabloc sc, aebsf hcl, pefabloc, 4-2-aminoethyl benzene-1-sulfonyl fluoride hydrochloride, aebsf, hydrochloride, benzenesulfonyl fluoride, 4-2-aminoethyl-, hydrochloride, 4-2-aminoethyl benzenesulfonylfluoride hydrochloride | |
| 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride |
Specifications
| 30827-99-7 | |
| 100.0 | |
| White | |
| 98% | |
| C8H10FNO2S·ClH | |
| 50 mg | |
| Solubility in water: 10g/L (20°C). Other solubilities: soluble in absolute ethanol | |
| C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl | |
| 239.7 | |
| 239.7 | |
| Powder |
| 97.5 | |
| 175.0°C to 177.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00132962 | |
| 4-2-aminoethyl benzenesulfonyl fluoride hydrochloride, aebsf, aebsf hydrochloride, pefabloc sc, aebsf hcl, pefabloc, 4-2-aminoethyl benzene-1-sulfonyl fluoride hydrochloride, aebsf, hydrochloride, benzenesulfonyl fluoride, 4-2-aminoethyl-, hydrochloride, 4-2-aminoethyl benzenesulfonylfluoride hydrochloride | |
| WRDABNWSWOHGMS-UHFFFAOYSA-N | |
| 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride | |
| 186136 | |
| 98% | |
| AEBSF hydrochloride, 98% |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsi
GHS Signal Word: Danger
RUO – Research Use Only